CymitQuimica logo

CAS 34632-69-4

:

ethyl 4-chloroquinazoline-2-carboxylate

Description:
Ethyl 4-chloroquinazoline-2-carboxylate is a chemical compound characterized by its quinazoline core, which is a bicyclic structure containing both benzene and pyrimidine rings. This compound features a chloro substituent at the 4-position and an ethyl ester functional group at the 2-position of the quinazoline ring. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chloro group can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Ethyl 4-chloroquinazoline-2-carboxylate is of interest in medicinal chemistry due to its potential biological activities, which may include antimicrobial or anticancer properties. Its synthesis often involves multi-step organic reactions, and it can serve as an intermediate in the development of more complex pharmaceutical agents. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C11H9ClN2O2
InChI:InChI=1/C11H9ClN2O2/c1-2-16-11(15)10-13-8-6-4-3-5-7(8)9(12)14-10/h3-6H,2H2,1H3
InChI key:ZMAJSODACDWUAS-UHFFFAOYSA-N
SMILES:CCOC(=O)c1nc2ccccc2c(Cl)n1
Synonyms:
  • 2-Quinazolinecarboxylic acid, 4-chloro-, ethyl ester
  • Ethyl 4-chloroquinazoline-2-carboxylate
Found 4 products.