CAS 34633-09-5
:(2E)-3-(4-iodophenyl)prop-2-enoic acid
Description:
(2E)-3-(4-iodophenyl)prop-2-enoic acid, also known as 4-iodo-cinnamic acid, is an organic compound characterized by its structure, which features a trans double bond between the second and third carbon atoms of a prop-2-enoic acid backbone, along with a para-iodophenyl group attached to the third carbon. This compound typically appears as a solid at room temperature and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic ring. The presence of the iodine atom enhances its reactivity and can influence its biological activity, making it of interest in various fields, including medicinal chemistry and materials science. The compound may exhibit properties such as UV absorbance due to the conjugated double bond system, which can be utilized in photochemical applications. Additionally, it may participate in various chemical reactions, including electrophilic substitutions and coupling reactions, making it a versatile building block in organic synthesis.
Formula:C9H7IO2
InChI:InChI=1/C9H7IO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6H,(H,11,12)/b6-3+
Synonyms:- (2E)-3-(4-Iodophenyl)acrylic acid
- 2-propenoic acid, 3-(4-iodophenyl)-, (2E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Iodocinnamic acid
CAS:<p>4-Iodocinnamic acid is a mesomorphic, supramolecular organic acid that has potent cytotoxicity against cancer cells. It is also an analogue of the natural product cinnamic acid. 4-Iodocinnamic acid binds to the active site of the enzyme DNA polymerase and inhibits DNA synthesis by preventing the incorporation of deoxynucleotide triphosphates into synthesized DNA chains. The compound has been shown to have strong antimicrobial activity against Gram-positive bacteria such as Staphylococcus aureus, Enterococcus faecalis, and Bacillus cereus. 4-Iodocinnamic acid is also an effective inhibitor of cancer cell proliferation and induces apoptosis in these cells.</p>Formula:C9H7IO2Purity:Min. 95%Color and Shape:PowderMolecular weight:274.06 g/mol
