CAS 34637-40-6

2-(hydroxymethyl)quinazolin-4(3H)-one

Description:

2-(Hydroxymethyl)quinazolin-4(3H)-one is a chemical compound characterized by its quinazolinone structure, which features a fused bicyclic system comprising a benzene ring and a pyrimidine ring. This compound contains a hydroxymethyl group (-CH2OH) at the 2-position of the quinazolinone, contributing to its reactivity and potential biological activity. It typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the hydroxymethyl group. The compound is of interest in medicinal chemistry, as quinazolinones are known for their diverse pharmacological properties, including anti-inflammatory, antimicrobial, and anticancer activities. Its molecular structure allows for various functional modifications, which can enhance its biological efficacy. The CAS number 34637-40-6 uniquely identifies this compound in chemical databases, facilitating research and development in various scientific fields, including drug discovery and organic synthesis.

Formula: C₉H₈N₂O₂

InChI: InChI=1/C9H8N2O2/c12-5-8-10-7-4-2-1-3-6(7)9(13)11-8/h1-4,12H,5H2,(H,10,11,13)

SMILES: c1ccc2c(c1)c(nc(CO)n2)O

2-(hydroxymethyl)-4(3H)-quinazolinone hydrochloride

CAS: 34637-40-6

Formula: C₉H₉ClN₂O₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 212.63

Ref: 10-F360613

2-(Hydroxymethyl)-3,4-dihydroquinazolin-4-one

CAS: 34637-40-6

2-(Hydroxymethyl)-3,4-dihydroquinazolin-4-one is an organic compound that belongs to the group of quinazolines. It is a fine chemical with CAS No. 34637-40-6. This product is a versatile building block for synthesis of complex compounds and can be used as a reaction component in organic chemistry. 2-(Hydroxymethyl)-3,4-dihydroquinazolin-4-one is a useful intermediate in the preparation of various pharmaceuticals, including antibiotics and antihypertensives. It is also used as a reagent in the laboratory or as a speciality chemical.

Formula: C₉H₈N₂O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 176.17 g/mol

Ref: 3D-JBA63740