CymitQuimica logo

CAS 346451-15-8

:

Piperazine, 1,4-bis[(4-chlorophenyl)phenylmethyl]-

Description:
Piperazine, 1,4-bis[(4-chlorophenyl)phenylmethyl]- is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 4. This compound features two 4-chlorophenyl groups attached to the piperazine ring via phenylmethyl linkages, contributing to its structural complexity and potential biological activity. The presence of chlorine substituents on the phenyl rings may enhance its lipophilicity and influence its interaction with biological targets. Typically, compounds with such structures are investigated for their pharmacological properties, including potential use as antipsychotic or antidepressant agents. The molecular structure suggests that it may exhibit significant interactions with neurotransmitter systems, although specific biological activities would require empirical investigation. Additionally, the compound's solubility, stability, and reactivity can be influenced by its substituents, making it a candidate for further research in medicinal chemistry and drug development. Safety and handling considerations should be observed due to the presence of chlorine, which can pose environmental and health risks.
Formula:C30H28Cl2N2
InChI:InChI=1S/C30H28Cl2N2/c31-27-15-11-25(12-16-27)29(23-7-3-1-4-8-23)33-19-21-34(22-20-33)30(24-9-5-2-6-10-24)26-13-17-28(32)18-14-26/h1-18,29-30H,19-22H2
InChI key:ZHKWYPRSELVIIG-UHFFFAOYSA-N
SMILES:C1CN(CCN1C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl)C(C4=CC=CC=C4)C5=CC=C(C=C5)Cl
Synonyms:
  • 1,4-Bis[(4-Chlorophenyl)Phenylmethyl]Piperazine Dihydrochloride
Found 10 products.