CAS 346459-51-6

3-bromo-4-[(3-fluorobenzyl)oxy]-5-methoxybenzaldehyde

Description:

3-Bromo-4-[(3-fluorobenzyl)oxy]-5-methoxybenzaldehyde is an organic compound characterized by its complex aromatic structure, which includes a bromine atom, a methoxy group, and a benzaldehyde functional group. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and polarity. The methoxy group contributes to the compound's electron-donating properties, enhancing its nucleophilicity. The 3-fluorobenzyl ether moiety adds steric bulk and can affect the compound's solubility and interaction with biological targets. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for research in medicinal chemistry. Its molecular structure suggests potential applications in the development of pharmaceuticals or agrochemicals. Additionally, the presence of multiple functional groups allows for various chemical modifications, which can be explored for enhancing its efficacy or selectivity in biological systems. Overall, 3-bromo-4-[(3-fluorobenzyl)oxy]-5-methoxybenzaldehyde represents a versatile compound with potential utility in various chemical and biological applications.

Formula: C₁₅H₁₂BrFO₃

InChI: InChI=1/C15H12BrFO3/c1-19-14-7-11(8-18)6-13(16)15(14)20-9-10-3-2-4-12(17)5-10/h2-8H,9H2,1H3

SMILES: COc1cc(cc(c1OCc1cccc(c1)F)Br)C=O

Synonyms:

• Benzaldehyde, 3-Bromo-4-[(3-Fluorophenyl)Methoxy]-5-Methoxy-

3-bromo-4-[(3-fluorobenzyl)oxy]-5-methoxybenzaldehyde

CAS: 346459-51-6

Formula: C₁₅H₁₂BrFO₃

Purity: 95.0%

Molecular weight: 339.16

Ref: 10-F314952