CymitQuimica logo

CAS 346459-54-9

:

3-Ethoxy-4-[(3-fluorophenyl)methoxy]benzaldehyde

Description:
3-Ethoxy-4-[(3-fluorophenyl)methoxy]benzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. The presence of an ethoxy group and a methoxy group attached to the benzene ring contributes to its chemical reactivity and solubility properties. The fluorine atom in the 3-fluorophenyl moiety can influence the compound's electronic properties, potentially enhancing its reactivity or altering its interaction with biological targets. This compound may exhibit interesting pharmacological activities due to its structural features, making it a candidate for research in medicinal chemistry. Its molecular structure suggests it could participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. Additionally, the compound's solubility in organic solvents and stability under standard laboratory conditions are typical characteristics of similar aromatic aldehydes. Overall, 3-Ethoxy-4-[(3-fluorophenyl)methoxy]benzaldehyde is a versatile compound with potential applications in synthetic organic chemistry and drug development.
Formula:C16H15FO3
InChI:InChI=1S/C16H15FO3/c1-2-19-16-9-12(10-18)6-7-15(16)20-11-13-4-3-5-14(17)8-13/h3-10H,2,11H2,1H3
InChI key:InChIKey=YQYJYTSFQKIJPK-UHFFFAOYSA-N
SMILES:O(CC1=CC(F)=CC=C1)C2=C(OCC)C=C(C=O)C=C2
Synonyms:
  • 3-Ethoxy-4-[(3-fluorophenyl)methoxy]benzaldehyde
  • Benzaldehyde, 3-ethoxy-4-[(3-fluorophenyl)methoxy]-
  • 3-Ethoxy-4-[(3-fluorobenzyl)oxy]benzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.