CAS 3465-61-0

3-(5-phenylfuran-2-yl)propanoic acid

Description:

3-(5-Phenylfuran-2-yl)propanoic acid, with the CAS number 3465-61-0, is an organic compound characterized by its unique structure that includes a furan ring and a propanoic acid moiety. This compound features a phenyl group attached to the furan, contributing to its aromatic properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, while its solubility in water is generally limited due to the hydrophobic nature of the phenyl and furan components. The presence of the carboxylic acid functional group allows for potential acid-base reactions and interactions with other molecules, making it of interest in various chemical syntheses and applications. Additionally, compounds with similar structures may exhibit biological activity, which could be explored in pharmaceutical research. Its stability under standard conditions is generally good, although it may be sensitive to strong acids or bases. Overall, 3-(5-phenylfuran-2-yl)propanoic acid is a compound of interest in organic chemistry and materials science.

Formula: C₁₃H₁₂O₃

InChI: InChI=1/C13H12O3/c14-13(15)9-7-11-6-8-12(16-11)10-4-2-1-3-5-10/h1-6,8H,7,9H2,(H,14,15)

SMILES: c1ccc(cc1)c1ccc(CCC(=O)O)o1

Synonyms:

• 2-Furanpropanoic acid, 5-phenyl-
• 3-(5-Phenyl-2-furyl)propanoic acid

3-(5-Phenyl-furan-2-yl)-propionic acid

CAS: 3465-61-0

Versatile small molecule scaffold

Formula: C₁₃H₁₂O₃

Purity: Min. 95%

Molecular weight: 216.24 g/mol

Ref: 3D-DAA46561