CAS 34653-56-0
:5-(1,3-benzothiazol-2-yl)furan-2-carbaldehyde
Description:
5-(1,3-benzothiazol-2-yl)furan-2-carbaldehyde is an organic compound characterized by its unique structure, which includes a furan ring and a benzothiazole moiety. This compound typically exhibits properties such as being a yellow to brown solid, with a moderate melting point. It is soluble in organic solvents like ethanol and dimethyl sulfoxide, but generally insoluble in water due to its hydrophobic nature. The presence of the aldehyde functional group contributes to its reactivity, making it a potential candidate for various chemical reactions, including condensation and nucleophilic addition. Additionally, the benzothiazole part of the molecule may impart biological activity, making it of interest in medicinal chemistry and material science. Its applications can range from use in organic synthesis to potential roles in pharmaceuticals, agrochemicals, or as a fluorescent probe in biochemical assays. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C12H7NO2S
InChI:InChI=1/C12H7NO2S/c14-7-8-5-6-10(15-8)12-13-9-3-1-2-4-11(9)16-12/h1-7H
SMILES:c1ccc2c(c1)nc(c1ccc(C=O)o1)s2
Synonyms:- 2-Furancarboxaldehyde, 5-(2-benzothiazolyl)-
- 5-(1,3-Benzothiazol-2-yl)-2-furaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-(Benzo[d]thiazol-2-yl)furan-2-carbaldehyde
CAS:5-(Benzo[d]thiazol-2-yl)furan-2-carbaldehydePurity:95%Molecular weight:229.26g/mol5-(1,3-Benzothiazol-2-yl)-2-furaldehyde
CAS:5-(1,3-Benzothiazol-2-yl)-2-furaldehyde is a benzothiazole that has been shown to be an effective lead compound for anticancer drug development. It has been shown to inhibit the growth of breast cancer cells in vitro and in vivo. 5-(1,3-Benzothiazol-2-yl)-2-furaldehyde's antitumor activity may be due to its ability to induce apoptosis by disrupting the cell cycle and inhibiting DNA synthesis. 5-(1,3-Benzothiazol-2-yl)-2-furaldehyde also binds to DNA and inhibits the function of both bacterial DNA gyrase and topoisomerase IV. It also possesses antiinflammatory properties which are due to its ability to inhibit prostaglandin synthesis.Formula:C12H7NO2SPurity:Min. 95%Molecular weight:229.25 g/mol


