CAS 34654-81-4
:6-[(3-Chloropropyl)amino]-1,3-dimethyl-2,4(1H,3H)-pyrimidinedione
Description:
6-[(3-Chloropropyl)amino]-1,3-dimethyl-2,4(1H,3H)-pyrimidinedione, with the CAS number 34654-81-4, is a chemical compound characterized by its pyrimidinedione core structure, which features a dimethyl substitution at the 1 and 3 positions and an amino group linked to a chloropropyl chain at the 6 position. This compound typically exhibits properties associated with pyrimidine derivatives, such as potential biological activity, including antimicrobial or antitumor effects, due to its ability to interact with biological targets. The presence of the chloropropyl group may enhance lipophilicity, influencing its solubility and permeability in biological systems. Additionally, the compound may participate in various chemical reactions typical of amines and halides, making it a candidate for further chemical modifications. Its stability, reactivity, and specific applications would depend on the conditions under which it is used, including pH, temperature, and the presence of other reagents. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.
Formula:C9H14ClN3O2
InChI:InChI=1S/C9H14ClN3O2/c1-12-7(11-5-3-4-10)6-8(14)13(2)9(12)15/h6,11H,3-5H2,1-2H3
InChI key:InChIKey=RPYBDDBZRQGARJ-UHFFFAOYSA-N
SMILES:N(CCCCl)C=1N(C)C(=O)N(C)C(=O)C1
Synonyms:- 2,4(1H,3H)-Pyrimidinedione, 6-[(3-chloropropyl)amino]-1,3-dimethyl-
- 6-(3-Chloropropyl)Amino-1.3-Dimethuracil
- 6-(3-chloropropylamino)-1,3-dimethylpyrimidine-2,4(1H,3H)-dione
- 6-[(3-Chloropropyl)amino]-1,3-dimethyl-2,4(1H,3H)-pyrimidinedione
- 6-[(3-chloropropyl)amino]-1,3-dimethylpyrimidine-2,4(1H,3H)-dione
- 6-{(3-Chloropropyl)Amino-1,3-Dimethuracil
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
6-[(3-Chloropropyl)amino]-1,3-dimethyluracil
CAS:Formula:C9H14ClN3O2Purity:>98.0%(HPLC)(N)Color and Shape:White to Light yellow powder to crystalMolecular weight:231.686-((3-Chloropropyl)amino)-1,3-dimethylpyrimidine-2,4(1H,3H)-dione
CAS:Formula:C9H14ClN3O2Purity:97%Color and Shape:SolidMolecular weight:231.6794Urapidil Impurity 1
CAS:Formula:C9H14ClN3O2Color and Shape:White To Off-White SolidMolecular weight:231.686-((3-Chloropropyl)amino)-1,3-dimethylpyrimidine-2,4(1H,3H)-dione
CAS:6-((3-Chloropropyl)amino)-1,3-dimethylpyrimidine-2,4(1H,3H)-dionePurity:99%Molecular weight:231.68g/mol6-(3-Chloropropylamino)-1,3-dimethyl-2,4(1H,3H)-pyrimidinedione
CAS:Controlled ProductApplications 6-(3-Chloropropylamino)-1,3-dimethyl-2,4(1H,3H)-pyrimidinedione is an impurity of Urapidil (U815400).
References Kubota, K., et al.: Bioorg. Med. Chem. Lett., 19, 2766 (2009),Formula:C9H14ClN3O2Color and Shape:Off-WhiteMolecular weight:231.686-(3-Chloropropylamino)-1,3-dimethyluracil
CAS:6-(3-Chloropropylamino)-1,3-dimethyluracil is a fine chemical that can be used as a versatile building block and a useful intermediate in research. It is also a speciality chemical that is useful for reactions involving complex compounds. 6-(3-Chloropropylamino)-1,3-dimethyluracil has been shown to react with many other chemicals, making it an excellent reagent. This chemical can be used as a building block or intermediate to create drugs such as antibiotics or anticancer agents.Formula:C9H14ClN3O2Purity:Min. 95%Color and Shape:PowderMolecular weight:231.68 g/mol6-((3-Chloropropyl)amino)-1,3-dimethylpyrimidine-2,4(1H,3H)-dione
CAS:Formula:C9H14ClN3O2Purity:97%Molecular weight:231.68







