CAS 3466-23-7
:9,10-dimethoxy-3,3-dimethyl-3H-chromeno[3,4-b]pyrano[2,3-h]chromen-7(13H)-one
Description:
9,10-Dimethoxy-3,3-dimethyl-3H-chromeno[3,4-b]pyrano[2,3-h]chromen-7(13H)-one, with CAS number 3466-23-7, is a complex organic compound characterized by its polycyclic structure, which includes chromene and pyran moieties. This compound typically exhibits a range of chemical properties, including solubility in organic solvents and potential reactivity due to the presence of methoxy groups and carbonyl functionalities. It may display biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of multiple aromatic rings contributes to its stability and potential for π-π stacking interactions. Additionally, the compound's structure suggests it may participate in various chemical reactions, such as electrophilic substitutions or nucleophilic additions, depending on the conditions. Its unique arrangement of functional groups may also influence its optical properties, making it a candidate for studies in photochemistry or materials science. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential applications in various fields.
Formula:C23H20O6
InChI:InChI=1/C23H20O6/c1-23(2)8-7-12-15(29-23)6-5-13-21(24)20-14-9-17(25-3)18(26-4)10-16(14)27-11-19(20)28-22(12)13/h5-10H,11H2,1-4H3
SMILES:CC1(C)C=Cc2c(ccc3c(=O)c4c5cc(c(cc5OCc4oc23)OC)OC)O1
Synonyms:- 3H-Bis(1)benzopyrano(3,4-b:6',5'-e)pyran-7(13H)-one, 9,10-dimethoxy-3,3-dimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Dehydrodeguelin
CAS:Dehydrodeguelin is a natural product of Derris, Fabaceae.Formula:C23H20O6Purity:98%Color and Shape:SolidMolecular weight:392.4Dehydrodeguelin
CAS:Dehydrodeguelin is a naturally derived insecticidal compound, which originates from the roots of plants in the Leguminosae family. With its mode of action centered on inhibiting the mitochondrial electron transport chain, it effectively leads to cellular energy depletion in target insects. This compound's ability to disrupt the normal physiological functions of pests makes it a valuable tool for integrated pest management strategies.Formula:C23H20O6Purity:Min. 95%Molecular weight:392.4 g/mol




