CAS 34662-31-2
:5-Chloro-2-nitrobenzonitrile
Description:
5-Chloro-2-nitrobenzonitrile is an organic compound characterized by the presence of a chloro group, a nitro group, and a nitrile functional group attached to a benzene ring. Its molecular structure consists of a benzene ring substituted at the 5-position with a chlorine atom and at the 2-position with a nitro group, while the nitrile group (-C≡N) is also attached to the benzene ring. This compound is typically a solid at room temperature and may exhibit a pale yellow to light brown color. It is known for its applications in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. The presence of both electron-withdrawing groups (the nitro and chloro substituents) can influence its reactivity, making it a useful intermediate in various chemical reactions. Additionally, safety precautions should be taken when handling this compound, as it may pose health risks, including potential toxicity and environmental hazards. Proper storage and disposal methods are essential to mitigate any risks associated with its use.
Formula:C7H3ClN2O2
InChI:InChI=1S/C7H3ClN2O2/c8-6-1-2-7(10(11)12)5(3-6)4-9/h1-3H
InChI key:InChIKey=HPWJUEZFOUOUEO-UHFFFAOYSA-N
SMILES:C(#N)C1=C(N(=O)=O)C=CC(Cl)=C1
Synonyms:- 1-Nitro-2-cyano-4-chlorobenzene
- 2-Nitro-5-chlorobenzonitrile
- 3-Chloro-6-nitrobenzonitrile
- Benzonitrile, 5-chloro-2-nitro-
- NSC 310024
- 5-Chloro-2-nitrobenzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Chloro-2-nitrobenzonitrile
CAS:Formula:C7H3ClN2O2Purity:98%Color and Shape:SolidMolecular weight:182.56395-Chloro-2-nitrobenzonitrile
CAS:5-Chloro-2-nitrobenzonitrile is a nucleophilic compound that inhibits bacterial growth by means of an attack on the sulfhydryl group. 5-Chloro-2-nitrobenzonitrile has shown antibacterial activity against Streptococcus faecalis and Staphylococcus aureus. This drug also has anti-inflammatory properties, which may be due to its ability to inhibit prostaglandin synthesis. The molecule has been shown to bind to chloride ions and sulfinyl groups, as well as being able to form a stable complex with erythrocytes in vitro (X-ray crystal structures). 5-Chloro-2-nitrobenzonitrile is structurally similar to fluoroquinolones and cephalosporins, which have been shown to have an oral bioavailability of 100%.Formula:C7H3ClN2O2Purity:Min. 95%Molecular weight:182.56 g/mol




