CAS 34662-32-3
:4-Chloro-2-nitrobenzonitrile
Description:
4-Chloro-2-nitrobenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom, a nitro group, and a cyano group. The presence of these functional groups imparts distinct chemical properties to the compound. The chlorine atom, being an electron-withdrawing group, enhances the electrophilicity of the aromatic ring, making it more reactive in electrophilic substitution reactions. The nitro group also contributes to the compound's reactivity and can influence its solubility in various solvents. 4-Chloro-2-nitrobenzonitrile is typically a solid at room temperature and may exhibit moderate to high toxicity, necessitating careful handling. It is used in various applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The compound's stability under standard conditions makes it suitable for various chemical reactions, although it may require specific conditions for optimal reactivity. As with many nitro compounds, it is important to consider its environmental impact and potential hazards during use and disposal.
Formula:C7H3ClN2O2
InChI:InChI=1S/C7H3ClN2O2/c8-6-2-1-5(4-9)7(3-6)10(11)12/h1-3H
InChI key:InChIKey=OZKOAADVLVCNFO-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C#N)C=CC(Cl)=C1
Synonyms:- 4-Chloro-2-nitrobenzonitrile
- NSC 93896
- Benzonitrile, 4-chloro-2-nitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzonitrile, 4-chloro-2-nitro-
CAS:Formula:C7H3ClN2O2Purity:97%Color and Shape:SolidMolecular weight:182.56394-Chloro-2-nitrobenzonitrile
CAS:4-Chloro-2-nitrobenzonitrileFormula:C7H3ClN2O2Purity:≥95%Color and Shape: lemon powderMolecular weight:182.56g/mol4-Chloro-2-nitrobenzonitrile
CAS:4-Chloro-2-nitrobenzonitrile is a nitroarene that can be used to synthesize gold nanoparticles. It has been shown to inhibit the growth of Candida parapsilosis, an opportunistic fungal pathogen, with a halide anion and a catalytic inorganic base. 4-Chloro-2-nitrobenzonitrile also inhibits the activity of butyrylcholinesterase, which is an enzyme that breaks down acetylcholine in the brain and nervous system. This compound may be useful in the synthesis of pharmaceuticals as well as other synthetic applications.
Formula:C7H3ClN2O2Molecular weight:182.56 g/mol4-Chloro-2-nitrobenzonitrile
CAS:Formula:C7H3ClN2O2Purity:98%Color and Shape:SolidMolecular weight:182.56



