CAS 34662-36-7
:3-Chloro-5-nitrobenzoic acid
Description:
3-Chloro-5-nitrobenzoic acid is an aromatic carboxylic acid characterized by the presence of both a chlorine and a nitro group on the benzene ring. Specifically, the chlorine atom is located at the meta position (3-position) relative to the carboxylic acid group, while the nitro group is situated at the para position (5-position). This compound typically appears as a yellow crystalline solid and is known for its moderate solubility in organic solvents and limited solubility in water. It exhibits acidic properties due to the carboxylic acid functional group, which can donate protons in solution. The presence of the electron-withdrawing chlorine and nitro groups influences its reactivity, making it a useful intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Additionally, 3-Chloro-5-nitrobenzoic acid can undergo various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in the development of more complex chemical entities. Safety precautions should be observed when handling this compound, as it may pose health risks.
Formula:C7H4ClNO4
InChI:InChI=1/C7H4ClNO4/c8-5-1-4(7(10)11)2-6(3-5)9(12)13/h1-3H,(H,10,11)
InChI key:InChIKey=YLQAJBKACBLUCM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(N(=O)=O)=CC(Cl)=C1
Synonyms:- 3-Nitro-5-chlorobenzoic acid
- Benzoic acid, 3-chloro-5-nitro-
- NSC 6112
- 3-Chloro-5-nitrobenzoic acid
- 3-Chloro-5-nitrobenzoic acid: 3-Nitro-5-chlorobenzoic acid
- 3-chloro-5-nitro-benzoic acid
- 3-Chloro-5-nitrobenzoic acid 98%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-chloro-5-nitro-benzoic acid
CAS:Formula:C7H4ClNO4Purity:98%Color and Shape:SolidMolecular weight:201.56403-Chloro-5-nitrobenzoic acid
CAS:3-Chloro-5-nitrobenzoic acidFormula:C7H4ClNO4Purity:98%Color and Shape: faint yellow/beige powderMolecular weight:201.56g/mol3-Chloro-5-nitrobenzoic acid
CAS:Formula:C7H4ClNO4Purity:96%Color and Shape:SolidMolecular weight:201.563-Chloro-5-nitrobenzoic acid
CAS:3-Chloro-5-nitrobenzoic acid is a potent antiparasitic drug that has been shown to be effective against filarial worms. It is metabolised in the liver to its active form, which inhibits the parasite's ability to produce ATP. 3-Chloro-5-nitrobenzoic acid has been found to be toxic at high doses and can also cause allergic reactions. This drug has been studied as a potential treatment for brugia, due to its structural similarities with benzamides and amides. The structures of analogues of 3-chloro-5-nitrobenzoic acid have been studied and they have shown promising results in gerbils infected with acanthocheilonema.
Formula:C7H4ClNO4Purity:Min. 95%Molecular weight:201.56 g/mol



