CAS 34662-58-3
:4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxylic acid
Description:
4-Oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxylic acid, with the CAS number 34662-58-3, is a heterocyclic compound characterized by a fused pyridine and pyrimidine ring system. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the keto group (4-oxo) enhances its stability and can influence its chemical behavior, including its ability to participate in various chemical reactions such as nucleophilic attacks or condensation reactions. The structure suggests that it may exhibit biological activity, potentially serving as a scaffold for drug development or as a precursor in synthetic organic chemistry. Its solubility and reactivity can vary depending on the solvent and conditions, making it a compound of interest in both medicinal chemistry and materials science. Overall, 4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxylic acid is notable for its unique structural features and potential applications in various chemical fields.
Formula:C9H6N2O3
InChI:InChI=1/C9H6N2O3/c12-8-6(9(13)14)5-10-7-3-1-2-4-11(7)8/h1-5H,(H,13,14)
SMILES:c1ccn2c(c1)ncc(c2=O)C(=O)O
Synonyms:- 4H-pyrido[1,2-a]pyrimidine-3-carboxylic acid, 4-oxo-
- Acide 4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxylique
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-oxopyrido[1,2-a]pyrimidine-3-carboxylic acid
CAS:Formula:C9H6N2O3Purity:97%Color and Shape:SolidMolecular weight:190.15554-oxopyrido[1,2-a]pyrimidine-3-carboxylic acid
CAS:4-oxopyrido[1,2-a]pyrimidine-3-carboxylic acidPurity:97%Molecular weight:190.16g/mol4-Oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxylic acid
CAS:Formula:C9H6N2O3Purity:97%Color and Shape:SolidMolecular weight:190.1584-Oxo-4H-Pyrido[1,2-A]Pyrimidine-3-Carboxylic Acid
CAS:4-Oxo-4H-pyrido[1,2-A]pyrimidine-3-carboxylic acid is a compound that has an analogy with the structure of pyridoxine. The structure of this molecule includes an alkoxycarbonyl group, a cycloalkyl group, and a phenyl group. This compound can be used as a medicine for gastroprotective purposes, and it also has anti-inflammatory properties. It is believed that 4-Oxo-4H-pyrido[1,2-A]pyrimidine-3-carboxylic acid can be used as a medicament to treat gastric ulcers.Formula:C9H6N2O3Purity:Min. 95%Molecular weight:190.16 g/mol



