CymitQuimica logo

CAS 34665-48-0

:

Carbamic acid, 1H-imidazol-4-yl-, 1,1-dimethylethyl ester (9CI)

Description:
Carbamic acid, 1H-imidazol-4-yl-, 1,1-dimethylethyl ester, also known by its CAS number 34665-48-0, is an organic compound characterized by its imidazole ring structure, which contributes to its biological activity and potential applications in pharmaceuticals. This compound features a carbamate functional group, which is known for its role in various biochemical processes and as a building block in medicinal chemistry. The presence of the tert-butyl ester group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. Typically, compounds of this nature may exhibit properties such as moderate stability under standard conditions, but they can be sensitive to hydrolysis, especially in the presence of strong acids or bases. Additionally, the imidazole moiety can participate in hydrogen bonding and coordination with metal ions, making it relevant in coordination chemistry and catalysis. Overall, this compound's unique structural features suggest it may have applications in drug development or as a biochemical probe, although specific biological activities would require further investigation.
Formula:C8H13N3O2
InChI:InChI=1S/C8H13N3O2/c1-8(2,3)13-7(12)11-6-4-9-5-10-6/h4-5H,1-3H3,(H,9,10)(H,11,12)
InChI key:XJNNJHSBTRIYHA-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC1=CN=CN1
Found 4 products.