CAS 34669-57-3
:Sulfolithocholic acid
Description:
Sulfolithocholic acid is a bile acid derivative characterized by its unique chemical structure, which includes a sulfonic acid group. It is a steroid compound that plays a role in the digestion and absorption of fats in the intestine. The presence of the sulfonic acid group enhances its solubility in water compared to other bile acids, facilitating its biological functions. Sulfolithocholic acid is typically found in the bile of certain animals and is involved in the emulsification of dietary lipids. Its molecular structure includes multiple hydroxyl groups, contributing to its amphipathic nature, which is crucial for its role as a surfactant in the digestive system. Additionally, this compound may have implications in various metabolic processes and could be studied for its potential effects on health and disease. As with many bile acids, its synthesis and regulation are tightly controlled within the body, reflecting its importance in maintaining lipid homeostasis.
Formula:C24H40O6S
InChI:InChI=1S/C24H40O6S/c1-15(4-9-22(25)26)19-7-8-20-18-6-5-16-14-17(30-31(27,28)29)10-12-23(16,2)21(18)11-13-24(19,20)3/h15-21H,4-14H2,1-3H3,(H,25,26)(H,27,28,29)/t15-,16-,17-,18+,19-,20+,21+,23+,24-/m1/s1
InChI key:InChIKey=AXDXVEYHEODSPN-HVATVPOCSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@]([C@]4(C)[C@](CC3)(C[C@H](OS(=O)(=O)O)CC4)[H])(CC1)[H])[H])(CC[C@@]2([C@@H](CCC(O)=O)C)[H])[H]
Synonyms:- (3α,5β)-3-(Sulfooxy)cholan-24-oic acid
- 3α-Sulfate-5β-cholan-24-oic acid
- Cholan-24-Oic Acid, 3-(Sulfooxy)-, (3Alpha,5Beta)-
- Cholan-24-oic acid, 3-(sulfooxy)-, (3α,5β)-
- Lithocholic acid 3-O-sulfate
- Lithocholic acid 3α-sulfate
- Sulfolithocholic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Sulfolithocholic acid
CAS:Sulfolithocholic acid is a bioactive chemical.
Formula:C24H40O6SColor and Shape:SolidMolecular weight:456.64Sulfolithocholic Acid Trimethylamine Salt
CAS:Controlled ProductApplications Sulfolithocholic Acid is an derivative of Lithocholic Acid (L469180), a cholic acid derivative and TGR5 modulator found in ox bile, human bile, rabbit bile, and in ox and pig gallstones.
References Kelsey, M. I., et al.: Chem. Carcinogen., 14, 205 (1981);Formula:C27H49NO6SColor and Shape:NeatMolecular weight:515.75

