CAS 346690-76-4

3-Pyrrolidinamine, 1-methyl-, hydrochloride (1:1), (3R)-

Description:

3-Pyrrolidinamine, 1-methyl-, hydrochloride (1:1), (3R)-, with the CAS number 346690-76-4, is a chemical compound characterized by its pyrrolidine structure, which is a five-membered nitrogen-containing heterocycle. This compound features a methyl group attached to the nitrogen atom of the pyrrolidine ring, contributing to its amine properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in aqueous solutions. The (3R)- designation indicates the specific stereochemistry at the chiral center, which can influence its biological activity and interactions. This compound may be of interest in pharmaceutical research due to its potential applications in medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. Its properties, such as melting point, solubility, and reactivity, would be influenced by the presence of the hydrochloride group, making it important for formulation and handling in laboratory settings.

Formula: C₅H₁₂N₂·ClH

InChI: InChI=1S/C5H12N2.ClH/c1-7-3-2-5(6)4-7;/h5H,2-4,6H2,1H3;1H/t5-;/m1./s1

InChI key: InChIKey=MXSDGEUYISCEJN-NUBCRITNSA-N

SMILES: N[C@H]1CN(C)CC1.Cl

Synonyms:

• (R)-1-Methylpyrrolidine-3-amine hydrochloride
• 3-Pyrrolidinamine, 1-methyl-, monohydrochloride, (3R)-
• 3-Pyrrolidinamine, 1-methyl-, hydrochloride (1:1), (3R)-

(3R)-1-Methylpyrrolidin-3-amine hydrochloride

CAS: 346690-76-4

Purity: 97%

Molecular weight: 136.6199951

Ref: 10-F637959