CAS 346704-04-9
:1-(4-nitro-3-piperidin-1-ylphenyl)piperazine
Description:
1-(4-nitro-3-piperidin-1-ylphenyl)piperazine is a chemical compound characterized by its complex structure, which includes a piperazine ring and a piperidine moiety, along with a nitro group attached to a phenyl ring. This compound typically exhibits properties associated with its functional groups, such as potential basicity due to the piperazine and piperidine rings, which can engage in hydrogen bonding and interact with biological targets. The presence of the nitro group may influence its reactivity and solubility, often enhancing its lipophilicity. This compound is of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as it may exhibit biological activity relevant to various therapeutic areas. Its molecular interactions can be studied through various analytical techniques, including spectroscopy and chromatography, to understand its behavior in biological systems. Safety and handling precautions are essential due to the potential toxicity associated with nitro compounds. Overall, this compound represents a significant area of research in drug discovery and development.
Formula:C15H22N4O2
InChI:InChI=1/C15H22N4O2/c20-19(21)14-5-4-13(17-10-6-16-7-11-17)12-15(14)18-8-2-1-3-9-18/h4-5,12,16H,1-3,6-11H2
SMILES:C1CCN(CC1)c1cc(ccc1N(=O)=O)N1CCNCC1
Synonyms:- Piperazine, 1-[4-Nitro-3-(1-Piperidinyl)Phenyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-(4-NITRO-3-PIPERIDIN-1-YL-PHENYL)-PIPERAZINE
CAS:Formula:C15H22N4O2Purity:95%Color and Shape:SolidMolecular weight:290.36081-(4-Nitro-3-piperidin-1-ylphenyl)piperazine
CAS:1-(4-Nitro-3-piperidin-1-ylphenyl)piperazinePurity:95%Molecular weight:290.37g/mol1-(4-nitro-3-piperidin-1-ylphenyl)piperazine
CAS:Formula:C15H22N4O2Purity:95%Color and Shape:SolidMolecular weight:290.3671-(4-Nitro-3-piperidin-1-ylphenyl)piperazine
CAS:1-(4-Nitro-3-piperidin-1-ylphenyl)piperazine is a synthetic molecule that is used as a polymerization initiator. It can be used to prepare polymers with functional groups that contain nitro and piperidine groups. 1-(4-Nitro-3-piperidin-1-ylphenyl)piperazine reacts with monomers such as thiourea, which are then polymerized by the addition of other reagents such as solvents or catalysts. The most common use of 1-(4-Nitro-3-piperidin-1-ylphenyl)piperazine is in the synthesis of nalidixic acid, an antibiotic drug that inhibits bacterial growth by preventing DNA replication. This compound has been shown to be nonhazardous to humans and animals in bioassays, although it may cause toxic effects on the skin, eyes, and respiratory system when exposedFormula:C15H22N4O2Purity:Min. 95%Molecular weight:290.36 g/mol



