CAS 346735-24-8
:Amelubant
Description:
Amelubant, identified by the CAS number 346735-24-8, is a chemical compound that has garnered attention in pharmaceutical research, particularly for its potential therapeutic applications. It is classified as a selective antagonist of the chemokine receptor CCR2, which plays a significant role in inflammatory processes and immune responses. The compound's mechanism of action involves inhibiting the binding of chemokines to CCR2, thereby modulating inflammatory pathways. This characteristic makes Amelubant a candidate for treating conditions associated with chronic inflammation, such as certain autoimmune diseases and cardiovascular disorders. In terms of physical properties, specific details such as solubility, melting point, and stability may vary and are typically determined through experimental studies. As with many pharmaceutical compounds, safety and efficacy are evaluated through clinical trials to establish appropriate dosing and potential side effects. Overall, Amelubant represents a promising area of research in the development of targeted therapies for inflammatory diseases.
Formula:C33H34N2O5
InChI:InChI=1/C33H34N2O5.C2H6/c1-4-38-32(37)35-23-34-28-12-18-31(19-13-28)40-22-25-7-5-6-24(20-25)21-39-30-16-10-27(11-17-30)33(2,3)26-8-14-29(36)15-9-26;1-2/h5-20,23,36H,4,21-22H2,1-3H3,(H,34,35,37);1-2H3
InChI key:InChIKey=SBVYURPQULDJTI-UHFFFAOYSA-N
SMILES:C(C)(C)(C1=CC=C(OCC2=CC(COC3=CC=C(C(NC(OCC)=O)=N)C=C3)=CC=C2)C=C1)C4=CC=C(O)C=C4
Synonyms:- Amelubant
- Biil-284
- Carbamic acid, N-[[4-[[3-[[4-[1-(4-hydroxyphenyl)-1-methylethyl]phenoxy]methyl]phenyl]methoxy]phenyl]iminomethyl]-, ethyl ester
- Carbamic acid, [[4-[[3-[[4-[1-(4-hydroxyphenyl)-1-methylethyl]phenoxy]methyl]phenyl]methoxy]phenyl]iminomethyl]-, ethyl ester
- ethyl {(E)-[(4-{[3-({4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy}methyl)benzyl]oxy}phenyl)amino]methylidene}carbamate - ethane (1:1)
- (BIIL284
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Amelubant
CAS:<p>Amelubant is a synthetic compound designed for use in detailed biochemical research and therapeutic investigations. As a product derived from innovative chemical synthesis techniques, Amelubant is engineered to interact with particular biological pathways, predominantly in the field of inflammatory response modulation. Its mode of action involves specific binding to target receptors, influencing downstream signaling cascades.</p>Formula:C33H34N2O5Purity:Min. 95%Molecular weight:538.6 g/molAmelubant
CAS:Amelubant (BIIL 284) is a prodrug of active metabolites BIIL 260 and BIIL 315 with anti-inflammatory activity[1]. It is a potent, oral, long-acting LTB4 receptor antagonist that negligibly binds to the LTB4 receptor, exhibiting Kis of 221 nM and 230 nM in vital cells and membranes.Formula:C33H34N2O5Purity:98%Color and Shape:SolidMolecular weight:538.63

