CymitQuimica logo

CAS 34675-74-6

:

(1-phenylethyl)hydrazine ethanedioate (1:1)

Description:
(1-Phenylethyl)hydrazine ethanedioate (1:1), with the CAS number 34675-74-6, is a chemical compound that features a hydrazine derivative linked to an ethanedioate (oxalic acid) moiety. This compound typically exhibits characteristics associated with both hydrazine and carboxylic acid derivatives, including potential reactivity due to the presence of the hydrazine functional group, which can participate in various chemical reactions such as condensation and oxidation. The ethanedioate portion may contribute to the compound's acidity and potential for forming salts or complexes. In terms of physical properties, it may be a solid at room temperature, with solubility in polar solvents, reflecting the presence of both hydrophilic and hydrophobic regions in its structure. The compound's applications could span areas such as organic synthesis, pharmaceuticals, or materials science, although specific uses would depend on its reactivity and stability under various conditions. Safety considerations should be taken into account, as hydrazine derivatives can be toxic and potentially hazardous.
Formula:C10H14N2O4
InChI:InChI=1/C8H12N2.C2H2O4/c1-7(10-9)8-5-3-2-4-6-8;3-1(4)2(5)6/h2-7,10H,9H2,1H3;(H,3,4)(H,5,6)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Mebanazine oxalate

    CAS:
    <p>Mebanazine oxalate is a potent monoamine oxidase (MAO) inhibitor. Mebanazine oxalate can be used in research of depression.</p>
    Formula:C10H14N2O4
    Color and Shape:Solid
    Molecular weight:226.23