CAS 34675-74-6

(1-phenylethyl)hydrazine ethanedioate (1:1)

Description:

(1-Phenylethyl)hydrazine ethanedioate (1:1), with the CAS number 34675-74-6, is a chemical compound that features a hydrazine derivative linked to an ethanedioate (oxalic acid) moiety. This compound typically exhibits characteristics associated with both hydrazine and carboxylic acid derivatives, including potential reactivity due to the presence of the hydrazine functional group, which can participate in various chemical reactions such as condensation and oxidation. The ethanedioate portion may contribute to the compound's acidity and potential for forming salts or complexes. In terms of physical properties, it may be a solid at room temperature, with solubility in polar solvents, reflecting the presence of both hydrophilic and hydrophobic regions in its structure. The compound's applications could span areas such as organic synthesis, pharmaceuticals, or materials science, although specific uses would depend on its reactivity and stability under various conditions. Safety considerations should be taken into account, as hydrazine derivatives can be toxic and potentially hazardous.

Formula: C₁₀H₁₄N₂O₄

InChI: InChI=1/C8H12N2.C2H2O4/c1-7(10-9)8-5-3-2-4-6-8;3-1(4)2(5)6/h2-7,10H,9H2,1H3;(H,3,4)(H,5,6)

Mebanazine oxalate

CAS: 34675-74-6

Mebanazine oxalate is a potent monoamine oxidase (MAO) inhibitor. Mebanazine oxalate can be used in research of depression.

Formula: C₁₀H₁₄N₂O₄

Color and Shape: Solid

Molecular weight: 226.23

Ref: TM-T33268