CAS 34677-78-6

4-{4-[bis(2-hydroxyethyl)amino]phenyl}butanoic acid

Description:

4-{4-[Bis(2-hydroxyethyl)amino]phenyl}butanoic acid, also known by its CAS number 34677-78-6, is an organic compound characterized by its structure, which includes a butanoic acid moiety linked to a phenyl group that is further substituted with a bis(2-hydroxyethyl)amino group. This compound typically exhibits properties such as solubility in polar solvents due to the presence of hydroxyl groups, which can engage in hydrogen bonding. It may also display amphiphilic characteristics, making it useful in various applications, including pharmaceuticals and as a surfactant. The presence of the amino groups suggests potential for biological activity, possibly interacting with biological systems or serving as a precursor for further chemical modifications. Additionally, the compound's structure may influence its melting point, boiling point, and reactivity, which are essential for its practical applications. Overall, 4-{4-[bis(2-hydroxyethyl)amino]phenyl}butanoic acid is a versatile compound with potential utility in both research and industrial contexts.

Formula: C₁₄H₂₁NO₄

InChI: InChI=1/C14H21NO4/c16-10-8-15(9-11-17)13-6-4-12(5-7-13)2-1-3-14(18)19/h4-7,16-17H,1-3,8-11H2,(H,18,19)

Dihydroxy Clorambucil

CAS: 34677-78-6

Formula: C₁₄H₂₁NO₄

Molecular weight: 267.33

Ref: ST-EA-CP-C66011