CAS 3468-99-3
:ethyl diphenylacetate
Description:
Ethyl diphenylacetate, with the CAS number 3468-99-3, is an organic compound classified as an ester. It is formed from the reaction of ethyl alcohol and diphenylacetic acid. This compound typically appears as a colorless to pale yellow liquid with a pleasant, fruity odor, making it useful in the fragrance industry. Ethyl diphenylacetate is characterized by its relatively low solubility in water but good solubility in organic solvents such as ethanol and ether. It has a moderate boiling point and exhibits stability under standard conditions, although it may undergo hydrolysis in the presence of strong acids or bases. The compound is primarily utilized in the synthesis of various organic compounds and as a flavoring agent due to its aromatic properties. Safety data indicates that it should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, ethyl diphenylacetate is a versatile compound with applications in both industrial and consumer products.
Formula:C16H16O2
InChI:InChI=1/C16H16O2/c1-2-18-16(17)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15H,2H2,1H3
SMILES:CCOC(=O)C(c1ccccc1)c1ccccc1
Synonyms:- Acetic acid, diphenyl-, ethyl ester
- Benzeneacetic acid, .alpha.-phenyl-, ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzeneacetic acid, a-phenyl-, ethyl ester
CAS:Formula:C16H16O2Purity:95%Color and Shape:SolidMolecular weight:240.2970Ethyl Diphenylacetate
CAS:Controlled ProductFormula:C16H16O2Color and Shape:NeatMolecular weight:240.30Ethyl diphenylacetate
CAS:Ethyl diphenylacetate is a trifluoromethyl group that has the potential for use as a fungicide. The hydrochloride salt of this compound exhibits high activity against various fungi, such as Rhizoctonia solani, Sclerotium rolfsii, and Botrytis cinerea. Ethyl diphenylacetate has also been shown to be an effective herbicide in plants, as it inhibits the enzyme acetolactate synthase and prevents the formation of branched-chain amino acids. It can also inhibit germination of seeds.Formula:C16H16O2Purity:Min. 95%Molecular weight:240.3 g/mol





