CAS 34680-81-4

2-Bromo-N-methylacetamide

Description:

2-Bromo-N-methylacetamide is an organic compound characterized by its bromo substituent and amide functional group. It features a bromine atom attached to the second carbon of the acetamide structure, which contributes to its reactivity and potential applications in organic synthesis. The presence of the N-methyl group enhances its solubility in polar solvents and can influence its biological activity. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its use in various chemical reactions, including nucleophilic substitutions and as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Safety considerations are important when handling this compound, as it may pose health risks due to the presence of bromine, which can be toxic. Proper storage and handling protocols should be followed to minimize exposure. Overall, 2-Bromo-N-methylacetamide is a versatile compound in synthetic organic chemistry with specific characteristics that make it valuable in research and industrial applications.

Formula: C₃H₆BrNO

InChI: InChI=1/C3H6BrNO/c1-5-3(6)2-4/h2H2,1H3,(H,5,6)

SMILES: CN=C(CBr)O

Synonyms:

• acetamide, 2-bromo-N-methyl-

Acetamide,2-bromo-N-methyl-

CAS: 34680-81-4

Formula: C₃H₆BrNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 151.9898

Ref: IN-DA007CVM

2-Bromo-N-methylacetamide

CAS: 34680-81-4

2-Bromo-N-methylacetamide

Purity: 99%

Color and Shape: Solid

Molecular weight: 151.99g/mol

Ref: 54-OR939130

2-Bromo-N-methylacetamide

CAS: 34680-81-4

Formula: C₃H₆BrNO

Purity: 95%

Color and Shape: Solid, Low Melting Solid

Molecular weight: 151.991

Ref: 10-F043828