CymitQuimica logo

CAS 34681-24-8

:

Butocarboxim sulfoxide

Description:
Butocarboxim sulfoxide, identified by its CAS number 34681-24-8, is a chemical compound that belongs to the class of sulfoxides. It is characterized by the presence of a sulfoxide functional group, which consists of a sulfur atom bonded to an oxygen atom and to two carbon-containing groups. This compound is typically used in agricultural applications, particularly as a pesticide or herbicide, due to its ability to inhibit certain biological processes in target organisms. Butocarboxim sulfoxide is known for its moderate to low toxicity to humans and animals, making it a candidate for use in various formulations. Its physical properties may include a specific boiling point, melting point, and solubility characteristics that are typical of sulfoxides, which often exhibit polar behavior. Additionally, it may undergo various chemical reactions, including oxidation and reduction, which can affect its stability and efficacy in applications. As with all chemical substances, proper handling and safety measures should be observed to mitigate any potential risks associated with its use.
Formula:C7H14N2O3S
InChI:InChI=1S/C7H14N2O3S/c1-5(6(2)13(4)11)9-12-7(10)8-3/h6H,1-4H3,(H,8,10)
InChI key:InChIKey=RCTCYOQIGNPQJH-UHFFFAOYSA-N
SMILES:C(C(S(C)=O)C)(=NOC(NC)=O)C
Synonyms:
  • 2-Butanone, 3-(methylsulfinyl)-, O-((methylamino)carbonyl)oxime
  • 3-(Methylsulfinyl)-2-butanone O-((methylamino)carbonyl)oxime
  • 6,7-Dimethyl-4-Oxa-8-Thia-2,5-Diazanon-5-En-3-One 8-Oxide
  • Butocarboxim sulfoxide
  • 3-(Methylsulphinyl)butan-2-one O-((methylamino)carbonyl)oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.