CymitQuimica logo

CAS 34684-87-2

:

4-amino-2,6-dimethylpyrimidine-5-carbonitrile

Description:
4-Amino-2,6-dimethylpyrimidine-5-carbonitrile is a heterocyclic organic compound characterized by a pyrimidine ring substituted with an amino group and two methyl groups at the 2 and 6 positions, along with a cyano group at the 5 position. This compound typically appears as a crystalline solid and is soluble in polar solvents. Its molecular structure contributes to its potential biological activity, making it of interest in pharmaceutical research, particularly in the development of antimicrobial and antiviral agents. The presence of the amino group allows for hydrogen bonding, which can enhance its reactivity and interaction with biological targets. Additionally, the cyano group may impart unique electronic properties, influencing the compound's overall reactivity and stability. As with many pyrimidine derivatives, it may exhibit a range of chemical behaviors, including nucleophilic and electrophilic reactions, making it versatile in synthetic organic chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H8N4
InChI:InChI=1/C7H8N4/c1-4-6(3-8)7(9)11-5(2)10-4/h1-2H3,(H2,9,10,11)
SMILES:Cc1c(C#N)c(=N)nc(C)[nH]1
Synonyms:
  • 5-Pyrimidinecarbonitrile, 4-Amino-2,6-Dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.