CAS 34688-70-5
:Pentamethylphenylacetonitrile
Description:
Pentamethylphenylacetonitrile, with the CAS number 34688-70-5, is an organic compound characterized by its unique structure, which includes a phenyl group substituted with five methyl groups and a nitrile functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its relatively low volatility and moderate solubility in organic solvents, making it useful in various chemical applications. The presence of the nitrile group imparts certain reactivity, allowing it to participate in nucleophilic addition reactions and other transformations. Pentamethylphenylacetonitrile is often utilized in synthetic organic chemistry, particularly in the synthesis of more complex molecules. Additionally, its unique steric and electronic properties can influence reaction pathways and product distributions. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled, and appropriate personal protective equipment should be used.
Formula:C13H17N
InChI:InChI=1/C13H17N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6H2,1-5H3
SMILES:Cc1c(C)c(C)c(CC#N)c(C)c1C
Synonyms:- 2,3,4,5,6-Pentamethylbenzyl cyanide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Pentamethylphenylacetonitrile
CAS:Pentamethylphenylacetonitrile (PMP) is an aldehyde that is used as a reagent in the synthesis of other chemical compounds. It is also used in the preparation of phase transfer catalysts. PMP is typically available as a white powder and can be dissolved in organic solvents such as acetone or benzene. The chemical properties of PMP are similar to those of other aldehydes, including its susceptibility to oxidation, which can lead to the formation of carboxylic acids.
Formula:C13H17NPurity:Min. 95%Molecular weight:187.28 g/molRef: 3D-JBA68870
Discontinued product



