CAS 3469-26-9
:2,7-Dimethoxynaphthalene
Description:
2,7-Dimethoxynaphthalene is an organic compound characterized by its naphthalene backbone, which consists of two fused benzene rings. The presence of two methoxy groups (-OCH3) at the 2 and 7 positions of the naphthalene structure significantly influences its chemical properties and reactivity. This compound is typically a white to pale yellow solid with a characteristic aromatic odor. It is relatively insoluble in water but soluble in organic solvents such as ethanol, ether, and chloroform. 2,7-Dimethoxynaphthalene can be used in various applications, including as an intermediate in organic synthesis and in the production of dyes and fragrances. Its chemical stability and ability to undergo electrophilic substitution reactions make it a valuable compound in synthetic organic chemistry. Additionally, the methoxy groups can participate in hydrogen bonding and influence the compound's electronic properties, potentially affecting its behavior in different chemical environments. Safety precautions should be taken when handling this compound, as with many aromatic compounds, due to potential health hazards.
Formula:C12H12O2
InChI:InChI=1S/C12H12O2/c1-13-11-5-3-9-4-6-12(14-2)8-10(9)7-11/h3-8H,1-2H3
InChI key:InChIKey=PPKHAIRFQKFMLE-UHFFFAOYSA-N
SMILES:O(C)C1=CC2=C(C=CC(OC)=C2)C=C1
Synonyms:- 2,7-dimethoxyl Naphthalene
- NSC 28991
- Naphthalene, 2,7-dimethoxy-
- 2,7-Dimethoxynaphthalene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,7-Dimethoxynaphthalene
CAS:Formula:C12H12O2Purity:>98.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:188.232,7-Dimethoxynaphthalene
CAS:Formula:C12H12O2Purity:95.0%Color and Shape:SolidMolecular weight:188.226Naphthalene, 2,7-dimethoxy-
CAS:Formula:C12H12O2Purity:97%Color and Shape:SolidMolecular weight:188.22252,7-Dimethoxynaphthalene
CAS:2,7-DimethoxynaphthalenePurity:98%Color and Shape:Pale Yellow PowderMolecular weight:188.22g/mol2,7-Dimethoxynaphthalene
CAS:2,7-Dimethoxynaphthalene is an imine molecule that can be synthesized by electrochemical methods. It has been used as a reagent in analytical chemistry and chemical synthesis. The compound was used for the preparation of diagnostic amido derivatives, which were used for the detection of naphthalene residues in clinical samples. 2,7-Dimethoxynaphthalene was also used to prepare ethyl diazoacetate, which was applied in the synthesis of polymers and plastics.Formula:C12H12O2Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:188.22 g/mol




