
CAS 34690-00-1
:P,P′,P′′,P′′′-[[(Phosphonomethyl)imino]bis[6,1-hexanediylnitrilobis(methylene)]]tetrakis[phosphonic acid]
Description:
P,P′,P′′,P′′′-[[(Phosphonomethyl)imino]bis[6,1-hexanediylnitrilobis(methylene)]]tetrakis[phosphonic acid], with CAS number 34690-00-1, is a complex organophosphorus compound characterized by its multiple phosphonic acid functional groups. This substance features a unique structure that includes phosphonomethyl and imino linkages, contributing to its potential applications in various fields, including agriculture and water treatment. The presence of multiple phosphonic acid groups enhances its ability to chelate metal ions, making it useful in formulations aimed at improving nutrient availability in soil or preventing metal ion toxicity. Additionally, its intricate molecular architecture may impart specific properties such as solubility in water and stability under various pH conditions. The compound's functionality is further augmented by the presence of long hydrocarbon chains, which can influence its interaction with biological systems and environmental factors. Overall, this compound exemplifies the versatility of phosphonic acids in both industrial and research applications, particularly in the context of enhancing agricultural productivity and environmental sustainability.
Formula:C17H44N3O15P5
InChI:InChI=1S/C17H44N3O15P5/c21-36(22,23)13-18(9-5-1-3-7-11-19(14-37(24,25)26)15-38(27,28)29)10-6-2-4-8-12-20(16-39(30,31)32)17-40(33,34)35/h1-17H2,(H2,21,22,23)(H2,24,25,26)(H2,27,28,29)(H2,30,31,32)(H2,33,34,35)
InChI key:InChIKey=YWMWZKYVGNWJPU-UHFFFAOYSA-N
SMILES:N(CCCCCCN(CP(=O)(O)O)CP(=O)(O)O)(CCCCCCN(CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O
Synonyms:- P,P′,P′′,P′′′-[[(Phosphonomethyl)imino]bis[6,1-hexanediylnitrilobis(methylene)]]tetrakis[phosphonic acid]
- Unihib 1704
- Phosphonic acid, [[(phosphonomethyl)imino]bis[6,1-hexanediylnitrilobis(methylene)]]tetrakis-
- Triaminodihexylenepentakis(methylenephosphonic acid)
- Phosphonic acid, P,P′,P′′,P′′′-[[(phosphonomethyl)imino]bis[6,1-hexanediylnitrilobis(methylene)]]tetrakis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
[bis[6-[bis(phosphonomethyl)amino]hexyl]amino]methylphosphonic acid
CAS:Formula:C17H44N3O15P5Color and Shape:LiquidMolecular weight:685.4112
