CAS 347-63-7
:3-Fluoro-4-methoxy-γ-oxobenzenebutanoic acid
Description:
3-Fluoro-4-methoxy-γ-oxobenzenebutanoic acid, with the CAS number 347-63-7, is a chemical compound that features a benzenebutanoic acid structure modified by the presence of a fluorine atom and a methoxy group. This compound typically exhibits characteristics such as being a solid at room temperature, with potential applications in pharmaceuticals or organic synthesis due to its unique functional groups. The presence of the fluorine atom can enhance lipophilicity and influence biological activity, while the methoxy group may contribute to the compound's reactivity and solubility in organic solvents. The γ-oxobenzenebutanoic acid structure suggests that it may participate in various chemical reactions, including esterification and acylation. Additionally, the compound's acidity is influenced by the carboxylic acid functional group, which can engage in hydrogen bonding and affect its interaction with other molecules. Overall, this compound's specific properties, such as melting point, boiling point, and solubility, would need to be determined through experimental data for precise applications and behavior in different environments.
Formula:C11H11FO4
InChI:InChI=1S/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15)
InChI key:InChIKey=SNRFVYKMDZSFED-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)(=O)C1=CC(F)=C(OC)C=C1
Synonyms:- Propionic acid, 3-(3-fluoro-p-anisoyl)-
- 3-(3-Fluoro-4-methoxybenzoyl)propionic acid
- Benzenebutanoic acid, 3-fluoro-4-methoxy-γ-oxo-
- 3-Fluoro-4-methoxy-γ-oxobenzenebutanoic acid
- NSC 87577
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(3-Fluoro-4-methoxyphenyl)-4-oxobutanoic acid
CAS:Formula:C11H11FO4Purity:97%Color and Shape:SolidMolecular weight:226.20103-(3-Fluoro-4-methoxybenzoyl)propanoic acid
CAS:3-(3-Fluoro-4-methoxybenzoyl)propanoic acidFormula:C11H11FO4Purity:97%Color and Shape: white to off-white solidMolecular weight:226.20g/mol3-(3-Fluoro-4-methoxybenzoyl)propionic acid
CAS:3-(3-Fluoro-4-methoxybenzoyl)propionic acid is a versatile building block that is used in the synthesis of many organic compounds. 3-(3-Fluoro-4-methoxybenzoyl)propionic acid has been used as a reagent in the synthesis of pharmaceuticals and other chemicals. 3-(3-Fluoro-4-methoxybenzoyl)propionic acid can be used to produce high quality research chemicals, speciality chemicals, and fine chemicals. This compound is also used to produce complex compounds and useful intermediates. 3-(3-Fluoro-4-methoxybenzoyl)propionic acid is available through chemical suppliers such as Sigma Aldrich or Acros Organics.Formula:C11H11FO4Purity:Min. 95%Molecular weight:226.2 g/mol4-(3-Fluoro-4-methoxyphenyl)-4-oxobutyric acid
CAS:Formula:C11H11FO4Purity:97%Color and Shape:SolidMolecular weight:226.203



