CAS 347-91-1

2-(4-fluorophenyl)-1-phenylethanone

Description:

2-(4-Fluorophenyl)-1-phenylethanone, also known as benzyl 4-fluorobenzyl ketone, is an organic compound characterized by its ketone functional group. It features a phenyl group and a 4-fluorophenyl substituent attached to a central carbon atom, which is also bonded to a carbonyl group (C=O). This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It has a relatively high boiling point and moderate solubility in organic solvents, making it useful in various chemical applications. The presence of the fluorine atom enhances its reactivity and can influence its electronic properties, making it valuable in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, its structure allows for potential applications in materials science and as an intermediate in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.

Formula: C₁₄H₁₁FO

InChI: InChI=1/C14H11FO/c15-13-8-6-11(7-9-13)10-14(16)12-4-2-1-3-5-12/h1-9H,10H2

SMILES: c1ccc(cc1)C(=O)Cc1ccc(cc1)F

Synonyms:

• Ethanone, 2-(4-fluorophenyl)-1-phenyl-

2-(4-Fluorophenyl)acetophenone

CAS: 347-91-1

Formula: C₁₄H₁₁FO

Purity: 97%

Color and Shape: Solid

Molecular weight: 214.2349

Ref: IN-DA00C9YE

2-(4-Fluorophenyl)acetophenone

CAS: 347-91-1

2-(4-Fluorophenyl)acetophenone

Formula: C₁₄H₁₁FO

Purity: ≥95%

Color and Shape: pale salmon crystalline powder

Molecular weight: 214.23g/mol

Ref: 54-PC421018

2-(4-Fluorophenyl)acetophenone

CAS: 347-91-1

Formula: C₁₄H₁₁FO

Purity: 97%

Color and Shape: Liquid, No data available.

Molecular weight: 214.239

Ref: 10-F022897