CAS 34702-59-5
:L-PENTAFLUOROPHE
Description:
L-Pentafluorophenol, with the CAS number 34702-59-5, is a fluorinated aromatic compound characterized by the presence of five fluorine atoms attached to a phenolic structure. This compound typically exhibits high thermal stability and low volatility due to the strong C-F bonds, which also contribute to its unique chemical reactivity. L-Pentafluorophenol is known for its acidic properties, making it a useful reagent in various chemical syntheses, particularly in the formation of fluorinated compounds. Its high electronegativity and electron-withdrawing nature of the fluorine substituents can significantly influence the reactivity and polarity of the molecule. Additionally, L-pentafluorophenol is often utilized in the development of advanced materials and in the pharmaceutical industry for the synthesis of biologically active compounds. Safety considerations are important when handling this substance, as it can be hazardous due to its corrosive nature and potential environmental impact. Overall, L-pentafluorophenol is a valuable compound in both research and industrial applications.
Formula:C9H6F5NO2
InChI:InChI=1/C9H6F5NO2/c10-4-2(1-3(15)9(16)17)5(11)7(13)8(14)6(4)12/h3H,1,15H2,(H,16,17)/t3-/m1/s1
SMILES:C(c1c(c(c(c(c1F)F)F)F)F)[C@H](C(=O)O)N
Synonyms:- (S)-2-Amino-3-Pentafluorophenyl-Propionic Acid
- Rarechem Bk Pt 0103
- Pentafluoro-L-Phenylalanine
- L-Pentafluorophenylalanine
- H-Phe(F5)-Oh
- H-Pentafluoro-Phe-Oh
- 2,3,4,5,6-pentafluoro-L-phenylalanine
- (2R)-2-ammonio-3-(pentafluorophenyl)propanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Pentafluoro-L-phenylalanine
CAS:Formula:C9H6F5NO2Purity:>95.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:255.14L-Phenylalanine, 2,3,4,5,6-pentafluoro-
CAS:Formula:C9H6F5NO2Purity:95%Color and Shape:SolidMolecular weight:255.1415(S)-2-Amino-3-(perfluorophenyl)propanoic acid
CAS:Formula:C9H6F5NO2Purity:95%Color and Shape:Solid, White to slightly pale yellow powderMolecular weight:255.1442,3,4,5,6-Pentafluoro-L-phenylalanine
CAS:2,3,4,5,6-Pentafluoro-L-phenylalanine (PFPA) is a substrate molecule that has been shown to inhibit the α1 subunit of the Na+/K+ ATPase in human heart cells. PFPA also inhibits the growth of bacteria in culture and is active against bacterial strains that have developed resistance to other antimicrobial agents. PFPA is also effective against bowel disease caused by H. pylori. PFPA has been shown to inhibit the production of an antimicrobial peptide by hl-60 cells in vitro and has been shown to be effective against a number of infectious diseases including tuberculosis and some autoimmune diseases.
Formula:C9H6F5NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:255.14 g/molRef: 3D-FP99622
Discontinued product




