
CAS 347155-76-4
:N-[[[4-[(6,7-Dimethoxy-4-quinolinyl)oxy]phenyl]amino]thioxomethyl]-2-methylbenzamide
Description:
N-[[[4-[(6,7-Dimethoxy-4-quinolinyl)oxy]phenyl]amino]thioxomethyl]-2-methylbenzamide is a complex organic compound characterized by its unique structural features, which include a quinoline moiety, a thioxomethyl group, and a benzamide backbone. This compound is likely to exhibit significant biological activity due to the presence of the quinoline ring, which is known for its pharmacological properties, including antimicrobial and antimalarial effects. The dimethoxy substitution on the quinoline enhances its lipophilicity, potentially improving its bioavailability. The thioxomethyl group may contribute to its reactivity and interaction with biological targets. Additionally, the presence of multiple aromatic rings suggests that the compound may engage in π-π stacking interactions, which can influence its binding affinity to proteins or enzymes. Overall, this compound's intricate structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, specific properties such as solubility, stability, and toxicity would require empirical investigation to fully understand its behavior in biological systems.
Formula:C26H23N3O4S
InChI:InChI=1S/C26H23N3O4S/c1-16-6-4-5-7-19(16)25(30)29-26(34)28-17-8-10-18(11-9-17)33-22-12-13-27-21-15-24(32-3)23(31-2)14-20(21)22/h4-15H,1-3H3,(H2,28,29,30,34)
InChI key:InChIKey=ZXGIBSBJQLLUEE-UHFFFAOYSA-N
SMILES:O(C=1C2=C(C=C(OC)C(OC)=C2)N=CC1)C3=CC=C(NC(NC(=O)C4=C(C)C=CC=C4)=S)C=C3
Synonyms:- PDGFR tyrosine kinase inhibitor V
- PDGF receptor tyrosine kinase inhibitor V
- Ki 11502
- Benzamide, N-[[[4-[(6,7-dimethoxy-4-quinolinyl)oxy]phenyl]amino]thioxomethyl]-2-methyl-
- N-[[[4-[(6,7-Dimethoxy-4-quinolinyl)oxy]phenyl]amino]thioxomethyl]-2-methylbenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ki11502
CAS:Ki11502 is a multi-target receptor tyrosine kinase (RTK) inhibitor that selectively inhibits the activity of PDGFβ/α receptors (with an IC50 of less than 10 nM). It specifically suppresses PDGFβ receptor phosphorylation, proliferation, and proteoglycan synthesis in human vascular smooth muscle cells. Additionally, Ki11502 induces apoptosis and exhibits significant antiproliferative effects against specific leukemia subgroups, including those with Imatinib-resistant mutations. It is particularly suitable for studying the role of PDGF in vascular diseases and the involvement of proteoglycans in atherosclerosis.Formula:C26H23N3O4SMolecular weight:473.54

