CAS 347187-30-8

Thieno[3,2-b]pyridine-2-carboxylic acid

Description:

Thieno[3,2-b]pyridine-2-carboxylic acid is a heterocyclic organic compound characterized by its fused thieno and pyridine rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, making it acidic and capable of participating in various chemical reactions, such as esterification and amidation. The presence of the thieno and pyridine moieties enhances its potential for biological activity, often making it a subject of interest in medicinal chemistry and drug development. Thieno[3,2-b]pyridine derivatives are known for their diverse pharmacological properties, including anti-inflammatory and antimicrobial activities. The compound's structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, its solubility and stability in various solvents can vary, influencing its behavior in different chemical environments. Overall, Thieno[3,2-b]pyridine-2-carboxylic acid is a versatile compound with significant implications in both synthetic chemistry and pharmacology.

Formula: C₈H₅NO₂S

InChI: InChI=1S/C8H5NO2S/c10-8(11)7-4-5-6(12-7)2-1-3-9-5/h1-4H,(H,10,11)

InChI key: InChIKey=WVWCTPQHJWMLKI-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC=2C(S1)=CC=CN2

Synonyms:

• Thieno[3,2-b]pyridine-2-carboxylic acid

Thieno[3,2-b]pyridine-2-carboxylic acid

CAS: 347187-30-8

Formula: C₈H₅NO₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 179.1958

Ref: IN-DA007CMA

Thieno[3,2-b]pyridine-2-carboxylic acid

CAS: 347187-30-8

Thieno[3,2-b]pyridine-2-carboxylic acid

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 179.20g/mol

Ref: 54-OR111149

Thieno[3,2-b]pyridine-2-carboxylic acid

CAS: 347187-30-8

Formula: C₈H₅NO₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 179.19

Ref: 10-F465208

Thieno[3,2-b]pyridine-2-carboxylic acid

CAS: 347187-30-8

Thieno[3,2-b]pyridine-2-carboxylic acid is a heterocyclic compound that contains a thieno[3,2-b]pyridine ring fused to a carboxylic acid. The substituents around the heteroatoms in this molecule are optimized for catalytic activity. Thieno[3,2-b]pyridine-2-carboxylic acid has been shown to react with sulfur via cycloadditions to form substituted thiophene rings. This compound also undergoes unsymmetrical carbonaceous cycloadditions with other compounds to form tricyclic compounds with appealing substituents.

Formula: C₈H₅NO₂S

Purity: Min. 95%

Molecular weight: 179.2 g/mol

Ref: 3D-XNA18730