CAS 34722-35-5

[(3-methylbenzyl)sulfanyl]acetate

Description:

[(3-Methylbenzyl)sulfanyl]acetate, with the CAS number 34722-35-5, is an organic compound characterized by the presence of a sulfanyl (thioether) functional group attached to an acetate moiety. This compound features a 3-methylbenzyl group, which contributes to its aromatic characteristics and potential for various chemical interactions. The sulfanyl group imparts unique reactivity, making it a candidate for nucleophilic substitution reactions. The acetate portion of the molecule suggests that it may exhibit ester-like properties, influencing its solubility and volatility. Typically, compounds of this nature can be used in organic synthesis, potentially serving as intermediates in the production of more complex molecules. The presence of the aromatic ring may also suggest potential applications in materials science or pharmaceuticals, where aromatic compounds often play a crucial role. Overall, the combination of these functional groups gives [(3-methylbenzyl)sulfanyl]acetate distinctive chemical properties that can be explored in various chemical contexts.

Formula: C₁₀H₁₂O₂S

InChI: InChI=1/C10H12O2S/c1-8-3-2-4-9(5-8)6-13-7-10(11)12/h2-5H,6-7H2,1H3,(H,11,12)

SMILES: Cc1cccc(c1)CSCC(=O)O

Synonyms:

• [(3-Methylbenzyl)Thio]Acetic Acid
• [(3-Methylbenzyl)Sulfanyl]Acetic Acid

2-{[(3-Methylphenyl)methyl]sulfanyl}acetic acid

CAS: 34722-35-5

Versatile small molecule scaffold

Formula: C₁₀H₁₂O₂S

Purity: Min. 95%

Molecular weight: 196.27 g/mol

Ref: 3D-JBA72235