CAS 34734-20-8
:1-ethyl-1H-benzimidazole-2-carbaldehyde
Description:
1-Ethyl-1H-benzimidazole-2-carbaldehyde is an organic compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features an ethyl group at the 1-position and an aldehyde functional group at the 2-position, contributing to its reactivity and potential applications in organic synthesis. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the presence of the aldehyde group. The compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and ability to act as a building block for more complex molecules. Its properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Safety data should be consulted, as with any chemical, to ensure proper handling and usage in laboratory settings.
Formula:C10H10N2O
InChI:InChI=1/C10H10N2O/c1-2-12-9-6-4-3-5-8(9)11-10(12)7-13/h3-7H,2H2,1H3
SMILES:CCn1c2ccccc2nc1C=O
Synonyms:- 1H-benzimidazole-2-carboxaldehyde, 1-ethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-Ethyl-1H-benzoimidazole-2-carbaldehyde
CAS:1-Ethyl-1H-benzoimidazole-2-carbaldehyde is a nonspecific heteroaromatic compound that has been shown to be sensitive to solvation. The conformers of this molecule have been determined by intramolecular sensitivity and regression analysis. This molecule is an intramolecular heteroaromatic compound with an electronic transition. The conformers are determined by the polarizability and electronic transitions of the molecule. This molecule has solvatochromism, which is a change in color due to changes in solvent polarity. 1-Ethyl-1H-benzoimidazole-2-carbaldehyde has been shown to exhibit conformational changes in response to changes in temperature, pressure, or solvent conditions, which can lead to changes in its physical properties such as color and melting point.Formula:C10H10N2OPurity:Min. 95%Molecular weight:174.2 g/molRef: 3D-JBA73420
Discontinued product

