CAS 347418-42-2
:4-Chloro-5-fluoropyrimidine
Description:
4-Chloro-5-fluoropyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of chlorine and fluorine substituents at the 4 and 5 positions, respectively, contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its reactivity, particularly in nucleophilic substitution reactions, due to the electron-withdrawing effects of the halogen substituents. 4-Chloro-5-fluoropyrimidine is often utilized in pharmaceutical and agrochemical research as a building block for the synthesis of various biologically active compounds. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, it is important to handle this compound with care, as halogenated pyrimidines can exhibit toxicity and environmental persistence.
Formula:C4H2ClFN2
InChI:InChI=1/C4H2ClFN2/c5-4-3(6)1-7-2-8-4/h1-2H
SMILES:c1c(c(Cl)ncn1)F
Synonyms:- Pyrimidine, 4-chloro-5-fluoro-
- 5-Fluoro-4-chloropyrimidine
- 4-Chloro-5-fluoropyrimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Pyrimidine, 4-chloro-5-fluoro- (9CI)
CAS:Formula:C4H2ClFN2Purity:95%Color and Shape:LiquidMolecular weight:132.52354-Chloro-5-fluoropyrimidine
CAS:4-Chloro-5-fluoropyrimidineFormula:C4H2ClFN2Purity:95%Color and Shape: pale yellow liquidMolecular weight:132.52g/mol4-Chloro-5-fluoropyrimidine
CAS:Formula:C4H2ClFN2Purity:95%Color and Shape:LiquidMolecular weight:132.524-Chloro-5-fluoropyrimidine
CAS:4-Chloro-5-fluoropyrimidine is a fluoropyrimidine that is used in the synthesis of pharmaceuticals, such as 4-amino-2-chloro-5-fluoropyrimidine. This compound is synthesized by chlorinating 4-chloro-5-fluoropyrimidine with chlorine gas. The resulting product is hydrolyzed to yield 4-amino-2,4,5,6 tetrafluoro pyrimidines. 4CFP can also be obtained by hydrogenolysis of toluene with chlorine gas and sodium hydroxide or hydrolyzing an ammonium salt with hydrochloric acid.
Formula:C4H2ClFN2Purity:Min. 95%Molecular weight:132.52 g/mol




