CAS 34743-89-0

2-(2-Bromophenoxy)ethanol

Description:

2-(2-Bromophenoxy)ethanol, with the CAS number 34743-89-0, is an organic compound characterized by its ether and alcohol functional groups. It features a bromophenyl moiety attached to an ethylene glycol unit, which contributes to its chemical properties. This compound is typically a colorless to pale yellow liquid, exhibiting moderate solubility in water due to the presence of the hydroxyl (-OH) group, while also being soluble in organic solvents. The bromine atom in its structure can impart unique reactivity, making it useful in various chemical syntheses and applications. It may exhibit biological activity, which can be of interest in pharmaceutical research. Additionally, the presence of both the ether and alcohol functionalities allows for potential interactions in various chemical environments, influencing its behavior in reactions such as nucleophilic substitutions or coupling reactions. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-(2-Bromophenoxy)ethanol is a versatile compound with applications in organic synthesis and potential biological relevance.

Formula: C₈H₉BrO₂

InChI: InChI=1S/C8H9BrO2/c9-7-3-1-2-4-8(7)11-6-5-10/h1-4,10H,5-6H2

InChI key: InChIKey=KKLBXMUYKQBAAB-UHFFFAOYSA-N

SMILES: O(CCO)C1=C(Br)C=CC=C1

Synonyms:

• Ethanol, 2-(2-bromophenoxy)-
• 2-(o-Bromophenoxy)ethanol
• β-(o-Bromophenoxy)ethanol
• 2-(2-Bromophenoxy)ethanol
• 2-(2-Bromophenoxy)ethan-1-ol

Ethanol, 2-(2-broMophenoxy)-

CAS: 34743-89-0

Formula: C₈H₉BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 217.0599

Ref: IN-DA00CMH4

2-(2-Bromophenoxy)ethanol

CAS: 34743-89-0

2-(2-Bromophenoxy)ethanol

Purity: 95%

Molecular weight: 217.06g/mol

Ref: 54-OR1050193

2-(2-Bromo-phenoxy)-ethanol

CAS: 34743-89-0

Formula: C₈H₉BrO₂

Purity: 95%;RG

Molecular weight: 217.062

Ref: 10-F086500

2-(2-Bromophenoxy)ethanol

CAS: 34743-89-0

2-(2-Bromophenoxy)ethanol is a primary alcohol that can be used as a probe in enzymatic reactions, such as the ring-opening of pyridinium salts. It reacts with nucleophilic compounds to form lactams, which are macrocyclic molecules. 2-(2-Bromophenoxy)ethanol can also be used to synthesize epoxides and alcohols.

Formula: C₈H₉BrO₂

Purity: Min. 95%

Molecular weight: 217.06 g/mol

Ref: 3D-JBA74389