CAS 34749-55-8
:(2E)-3-[4-(Acetyloxy)-3-methoxyphenyl]-2-propenoic acid
Description:
The chemical substance known as (2E)-3-[4-(Acetyloxy)-3-methoxyphenyl]-2-propenoic acid, with the CAS number 34749-55-8, is an organic compound characterized by its propenoic acid backbone, which features a trans configuration (2E). This compound contains a phenyl group substituted with both an acetyloxy and a methoxy group, contributing to its unique chemical properties. The presence of the acetyloxy group suggests potential reactivity, particularly in esterification or hydrolysis reactions. The methoxy group enhances the compound's solubility in organic solvents and may influence its biological activity. As a derivative of cinnamic acid, it may exhibit properties such as antioxidant activity, making it of interest in pharmacological and agricultural applications. Its structural features suggest potential interactions with biological systems, which could be explored for therapeutic uses. Overall, this compound exemplifies the complexity of organic molecules and their potential utility in various fields, including medicinal chemistry and agrochemicals.
Formula:C12H12O5
InChI:InChI=1S/C12H12O5/c1-8(13)17-10-5-3-9(4-6-12(14)15)7-11(10)16-2/h3-7H,1-2H3,(H,14,15)/b6-4+
InChI key:InChIKey=IHKNVZISLLDMOR-GQCTYLIASA-N
SMILES:O(C(C)=O)C1=C(OC)C=C(/C=C/C(O)=O)C=C1
Synonyms:- 2-Propenoic acid, 3-[4-(acetyloxy)-3-methoxyphenyl]-, (E)-
- trans-4-Acetoxy-3-methoxycinnamic acid
- 2-Propenoic acid, 3-[4-(acetyloxy)-3-methoxyphenyl]-, (2E)-
- 4′-Acetoxy-3′-methoxycinnamic acid
- (2E)-3-[4-(Acetyloxy)-3-methoxyphenyl]-2-propenoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
