CAS 3475-68-1

Indolylacryloylglycine

Description:

Indolylacryloylglycine is a chemical compound characterized by its unique structure, which combines an indole moiety with an acrylamide and glycine component. This compound typically exhibits properties associated with both indole derivatives and acrylamides, such as potential biological activity and reactivity. Indolylacryloylglycine may display interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its structure allows for possible interactions with biological targets, which could lead to various therapeutic applications. Additionally, the presence of the acrylamide group suggests that it may participate in polymerization reactions, potentially leading to the formation of new materials. The compound's solubility, stability, and reactivity can vary depending on environmental conditions such as pH and temperature. Overall, Indolylacryloylglycine represents a fascinating intersection of organic chemistry and biochemistry, warranting further investigation into its properties and potential uses in various fields.

Formula: C₁₃H₁₂N₂O₃

InChI: InChI=1S/C13H12N2O3/c16-12(15-8-13(17)18)6-5-9-7-14-11-4-2-1-3-10(9)11/h1-7,14H,8H2,(H,15,16)(H,17,18)

InChI key: InChIKey=DUIFVCFSAWHIOD-UHFFFAOYSA-N

SMILES: C(=CC(NCC(O)=O)=O)C=1C=2C(NC1)=CC=CC2

Synonyms:

• Glycine, N-(3-indol-3-ylacryloyl)-
• Glycine, N-[3-(1H-indol-3-yl)-1-oxo-2-propen-1-yl]-
• Glycine, N-[3-(1H-indol-3-yl)-1-oxo-2-propenyl]-
• Indolyl-3-acryloylglycine
• Indolylacryloylglycine
• N-(3-Indol-3-ylacryloyl)glycine
• N-(β-Indol-3-ylacryloyl)glycine
• N-[3-(1H-Indol-3-yl)-1-oxo-2-propen-1-yl]glycine
• glycine, N-[(2E)-3-(1H-indol-3-yl)-1-oxo-2-propen-1-yl]-

Indole-3-acryloylglycine

CAS: 3475-68-1

Indole-3-acryloylglycine is a metabolite of tryptophan, which is an essential amino acid for humans. It has been shown to be a potential biomarker for inflammatory bowel disease (IBD). Indole-3-acryloylglycine can be detected in urine samples and can be used as a diagnostic tool to identify IBD patients. This method has also been validated using chromatographic and mass spectrometry methods. Dietary intake of 3-hydroxyanthranilic acid or kynurenine may affect the concentration of indole-3-acryloylglycine in the body.

Formula: C₁₃H₁₂N₂O₃

Purity: Min. 98 Area-%

Color and Shape: White Off-White Powder

Molecular weight: 244.25 g/mol

Ref: 3D-FI172364