CAS 34769-44-3
:Sodium usnate
Description:
Sodium usnate, with the CAS number 34769-44-3, is a chemical compound derived from usnic acid, which is a natural product found in certain lichens. It is characterized by its potential antimicrobial and antifungal properties, making it of interest in various applications, including cosmetics and pharmaceuticals. Sodium usnate is typically presented as a sodium salt, which enhances its solubility in water compared to its parent compound, usnic acid. This solubility allows for easier incorporation into formulations. The compound is known for its distinctive yellow to orange color, which can vary depending on the concentration and formulation. Additionally, sodium usnate exhibits antioxidant properties, contributing to its appeal in skincare products. However, it is essential to note that while it has beneficial properties, its safety and efficacy should be evaluated in the context of specific applications, as with any bioactive compound. Overall, sodium usnate represents a versatile ingredient with potential uses in various industries, particularly in health and wellness.
Formula:C18H16O7·Na
InChI:InChI=1S/C18H16O7.Na/c1-6-14(22)12(8(3)20)16-13(15(6)23)18(4)10(25-16)5-9(21)11(7(2)19)17(18)24;/h5,11,22-23H,1-4H3;
InChI key:InChIKey=YGZOLUSJFYDOMD-UHFFFAOYSA-N
SMILES:CC12C=3C(OC1=CC(=O)C(C(C)=O)C2=O)=C(C(C)=O)C(O)=C(C)C3O.[Na]
Synonyms:- 1,3(2H,9bH)-Dibenzofurandione, 2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyl-, monosodium salt
- 1,3(2H,9bH)-dibenzofurandione, 2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyl-, sodium salt (1:1)
- Binan
- Sodium 4,8-Diacetyl-3-Hydroxy-2,9A-Dimethyl-7,9-Dioxo-7,8,9,9A-Tetrahydrodibenzo[B,D]Furan-1-Olate
- Sodium Usnate
- Usnic Acid Sodium
- Usnic acid sodium salt
- Usnic acid, sodium deriv.
- 2,6-Diacetyl-7,9-Dihydroxy-8,9B-Dimethyldibenzofuran-1,3(2H,9Bh)-Dione Monosodium Salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Usnic Acid sodium
CAS:Usnic Acid sodium is a natual product.Formula:C18H15NaO7Purity:≥95%Color and Shape:SolidMolecular weight:366.3Usnic Acid Sodium
CAS:Controlled Product<p>Applications Usnic Acid Sodium acts as an antibacterial and antifungal agent, and are often seen used in cosmetics and facial application chemicals.<br>References Ferrarese, L. et al.: Cosm. Tech. et al.: 11, 25 (2008); Coiffard, C. et al.: Annal. Pharm. Dranc., 57, 392 (1999);<br></p>Formula:C18H15O7·NaColor and Shape:Light YellowMolecular weight:366.302,6-Diacetyl-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3(2H,9bH)-dione monosodium
CAS:<p>2,6-Diacetyl-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3(2H,9bH)-dione monosodium is a synthetic compound, classified as a dibenzofuran derivative. This type of product is often sourced through controlled organic synthesis in laboratory settings, adhering to specific reactions that form the complex dibenzofuran structure. With a detailed mechanism of action involving potential interaction with specific biological pathways, this compound may exhibit bioactivity indicative of therapeutic properties, although detailed mechanistic studies are essential to fully elucidate its mode of action.</p>Formula:C18H16O7•NaPurity:Min. 95%Color and Shape:PowderMolecular weight:367.31 g/mol



