CAS 34775-04-7

ethyl 4-chloro-2-(3-pyridyl)pyrimidine-5-carboxylate

Description:

Ethyl 4-chloro-2-(3-pyridyl)pyrimidine-5-carboxylate, with the CAS number 34775-04-7, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidine ring substituted with a chloro group and a pyridyl moiety, contributing to its unique chemical properties. It is typically characterized by its moderate solubility in organic solvents, which is common for many heterocyclic compounds. The presence of both the ethyl ester and the chloro substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, which is often explored in medicinal chemistry for potential therapeutic applications. Its structural features suggest that it could interact with biological targets, making it of interest in drug development. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₂H₁₀ClN₃O₂

InChI: InChI=1/C12H10ClN3O2/c1-2-18-12(17)9-7-15-11(16-10(9)13)8-4-3-5-14-6-8/h3-7H,2H2,1H3

SMILES: CCOC(=O)c1cnc(c2cccnc2)nc1Cl

Synonyms:

• Ethyl 4-chloro-2-(pyridin-3-yl)pyrimidine-5-carboxylate

Ethyl 4-chloro-2-(pyridin-3-yl)pyrimidine-5-carboxylate

CAS: 34775-04-7

Formula: C₁₂H₁₀ClN₃O₂

Molecular weight: 263.6797

Ref: IN-DA007BTS

Ethyl 4-chloro-2-(pyridin-3-yl)pyrimidine-5-carboxylate

CAS: 34775-04-7

Ethyl 4-chloro-2-(pyridin-3-yl)pyrimidine-5-carboxylate

Purity: ≥95%

Molecular weight: 263.68g/mol

Ref: 54-OR62049