CAS 34786-70-4
:Nystatin A1
Description:
Nystatin A1 is a polyene antifungal antibiotic derived from the bacterium Streptomyces noursei. It is primarily used to treat fungal infections, particularly those caused by Candida species. Nystatin A1 exhibits a complex structure characterized by a series of conjugated double bonds, which contribute to its antifungal activity by binding to ergosterol in fungal cell membranes, leading to increased membrane permeability and cell death. This compound is typically administered topically or orally, depending on the type of infection being treated. Nystatin A1 is known for its low systemic absorption when taken orally, making it effective for localized infections with minimal side effects. It is also important to note that Nystatin A1 is not effective against bacterial infections, as its mechanism of action is specific to fungi. The substance is generally well-tolerated, but some individuals may experience local irritation or allergic reactions. Overall, Nystatin A1 remains a valuable therapeutic agent in the management of fungal infections.
Formula:C47H75NO17
InChI:InChI=1S/C47H75NO17/c1-27-17-15-13-11-9-7-5-6-8-10-12-14-16-18-34(64-46-44(58)41(48)43(57)30(4)63-46)24-38-40(45(59)60)37(54)26-47(61,65-38)25-36(53)35(52)20-19-31(49)21-32(50)22-33(51)23-39(55)62-29(3)28(2)42(27)56/h5-6,8,10-18,27-38,40-44,46,49-54,56-58,61H,7,9,19-26,48H2,1-4H3,(H,59,60)/b6-5+,10-8+,13-11+,14-12+,17-15+,18-16+/t27-,28-,29-,30+,31+,32+,33+,34-,35+,36+,37-,38-,40+,41-,42+,43+,44-,46-,47+/m0/s1
InChI key:InChIKey=VQOXZBDYSJBXMA-NQTDYLQESA-N
SMILES:C(O)(=O)[C@H]1[C@]2(O[C@@](O)(C[C@@H]1O)C[C@@H](O)[C@H](O)CC[C@@H](O)C[C@@H](O)C[C@@H](O)CC(=O)O[C@@H](C)[C@H](C)[C@H](O)[C@@H](C)\C=C\C=C\CC\C=C\C=C\C=C\C=C\[C@H](O[C@H]3[C@@H](O)[C@@H](N)[C@H](O)[C@@H](C)O3)C2)[H]
Synonyms:- (1S,3R,4R,7R,9R,11R,15S,16R,17R,18S,19E,21E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(3-Amino-3,6-dideoxy-β-<span class="text-smallcaps">D</span>-mannopyranosyl)oxy]-1,3,4,7,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,25,27,29,31-hexaene-36-carboxylic acid
- (1S,3R,4R,7R,9S,11S,15R,16S,17S,18R,33R,35S,36R,37S)-33-[(3-amino-3,6-dideoxy-β-D-mannopyranosyl)oxy]-1,3,4,7,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,25,27,29,31-hexaene-36-carboxylic acid
- (7R,10R)-8,9-Dideoxy-28,29-dihydro-7,10-dihydroxyamphotericin B
- 14,39-Dioxabicyclo[33.3.1]nonatriacontane, nystatin A<sub>1</sub> deriv.
- 34786-70-4
- Amphotericin B, 8,9-dideoxy-28,29-dihydro-7,10-dihydroxy-, (7R,10R)-
- Nystatin A<sub>1</sub>
- Stereoisomer of 33-[(3-amino-3,6-dideoxy-β-<span class="text-smallcaps">D</span>-mannopyranosyl)oxy]-1,3,4,7,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,25,27,29,31-hexaene-36-carboxylic acid
- 14,39-Dioxabicyclo[33.3.1]nonatriacontane, nystatin A1 deriv.
- Nystatin A1
- Stereoisomer of 33-[(3-amino-3,6-dideoxy-β-D-mannopyranosyl)oxy]-1,3,4,7,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,25,27,29,31-hexaene-36-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Nystatin A1
CAS:Nystatin A1, a polyene macrolide (antibiotic), is isolated from the Streptomyces noursei bacterium. It functions by binding with ergosterol on fungal cell membranes, enhancing membrane permeability, and consequently causing leakage of cellular contents, which inhibits fungal growth and reproduction.Formula:C47H75NO17Color and Shape:SolidMolecular weight:926.09


