CAS 3479-85-4

2,5-Dibromoadipic acid

Description:

2,5-Dibromoadipic acid is an organic compound characterized by the presence of two bromine atoms and a dicarboxylic acid functional group. Its molecular structure features a six-carbon chain with carboxylic acid groups (-COOH) at both ends, specifically at the 1 and 6 positions, and bromine substituents at the 2 and 5 positions. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its carboxylic acid groups. The presence of bromine atoms enhances its reactivity, making it useful in various chemical syntheses and applications, including as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, 2,5-dibromoadipic acid can participate in various chemical reactions, such as esterification and amidation, due to its functional groups. Its properties, including melting point and boiling point, can vary based on purity and environmental conditions. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.

Formula: C₆H₈Br₂O₄

InChI: InChI=1/C6H8Br2O4/c7-3(5(9)10)1-2-4(8)6(11)12/h3-4H,1-2H2,(H,9,10)(H,11,12)

InChI key: InChIKey=KABAKEOYQZKPBA-UHFFFAOYSA-N

SMILES: C(C(O)=O)(CCC(C(O)=O)Br)Br

Synonyms:

• 2,5-Dibromohexanedioic Acid
• Hexanedioic acid, 2,5-dibromo-
• NSC 243606
• α,α′-Dibromoadipic acid
• 2,5-Dibromoadipic acid
• 2,2'-DIBROMO ADIPIC ACID

2,5-Dibromoadipic acid

CAS: 3479-85-4

Formula: C₆H₈Br₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 303.9333

Ref: IN-DA00C8LG

2,5-Dibromohexanedioic acid

CAS: 3479-85-4

2,5-Dibromohexanedioic acid

Purity: 95%

Molecular weight: 303.93g/mol

Ref: 54-OR1051710

2,5-Dibromohexanedioic acid

CAS: 3479-85-4

Purity: 95.0%

Molecular weight: 303.9339904785156

Ref: 10-F242006

2,5-Dibromoadipic acid

CAS: 3479-85-4

2,5-Dibromoadipic acid is an organic compound that can be synthesized by oxidation of 2,5-dibromohexanoic acid with sodium periodate in aqueous alcohol. It is used as a monomer for the production of polymers and plastics such as polyurethanes and polyesters. The product is obtained in high yield and has a stereoselectivity of 99%. It can be purified by recrystallization from water or from organic solvents.
2,5-Dibromoadipic acid reacts with nucleophiles such as alcohols to form an addition compound. The addition reaction can be followed by spectroscopic methods such as diffraction or NMR. This reaction type is called nucleophilic addition.

Formula: C₆H₈Br₂O₄

Purity: Min. 95%

Molecular weight: 303.94 g/mol

Ref: 3D-DAA47985