CAS 348-28-7
:4-Fluorosalicylaldehyde
Description:
4-Fluorosalicylaldehyde, with the CAS number 348-28-7, is an organic compound that belongs to the class of aromatic aldehydes. It features a fluorine atom substituted at the para position of the salicylaldehyde structure, which consists of a benzene ring with both a hydroxyl group (-OH) and an aldehyde group (-CHO) attached. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to the reactivity of the aldehyde functional group and the influence of the fluorine atom on the electronic properties of the molecule. 4-Fluorosalicylaldehyde can participate in various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, it may exhibit interesting biological activities, making it a subject of research in medicinal chemistry. Proper handling and storage are essential, as with many organic compounds, to ensure safety and stability.
Formula:C7H5FO2
InChI:InChI=1/C7H5FO2/c8-6-2-1-5(4-9)7(10)3-6/h1-4,10H
SMILES:c1cc(cc(c1C=O)O)F
Synonyms:- 4-Fluoro-2-hydroxybenzaldehyde
- Benzaldehyde, 4-fluoro-2-hydroxy-
- 2-Hydroxy-4-fluorobenzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ref: IN-DA003LD1
1g26.00€5g50.00€10g61.00€1kgTo inquire25g126.00€50g194.00€100g255.00€250g535.00€250mg22.00€4-Fluoro-2-hydroxybenzaldehyde
CAS:4-Fluoro-2-hydroxybenzaldehydeFormula:C7H5FO2Purity:99%Color and Shape: pale yellow crystalline solidMolecular weight:140.11g/mol4-Fluoro-2-hydroxybenzaldehyde
CAS:Formula:C7H5FO2Purity:98%Color and Shape:SolidMolecular weight:140.1132-Hydroxy-4-fluorobenzaldehyde
CAS:2-Hydroxy-4-fluorobenzaldehyde is a chemical used as a diagnosis agent to detect radiation exposure. It reacts with magnesium and water molecules to form an amination reaction that produces hydrogen fluoride gas. 2-Hydoxy-4-fluorobenzaldehyde has been shown to have the ability to penetrate into mitochondria, which may be related to its use in the treatment of hepatitis. The chemical structure of this compound is similar to salicylaldehyde, which is used as a reagent for formylation reactions and optical properties. It has also been shown that 2-hydroxy-4-fluorobenzaldehyde can act as a fluorescence probe for the detection of hydrophobic regions on proteins.
Formula:C7H5FO2Purity:Min. 95%Color and Shape:PowderMolecular weight:140.11 g/mol



