CAS 348-45-8

N-(4-fluorophenyl)-1,3-benzothiazol-2-amine

Description:

N-(4-fluorophenyl)-1,3-benzothiazol-2-amine, with the CAS number 348-45-8, is an organic compound characterized by its unique structure that combines a benzothiazole moiety with a fluorophenyl group. This compound typically exhibits properties associated with both aromatic amines and heterocyclic compounds, including potential biological activity. The presence of the fluorine atom can influence its electronic properties, potentially enhancing lipophilicity and altering reactivity. It is often studied in the context of medicinal chemistry due to its potential applications in pharmaceuticals, particularly as a scaffold for drug development. The compound may exhibit various physical properties such as solubility in organic solvents and moderate stability under standard conditions. Additionally, its reactivity can be influenced by the amine functional group, allowing for further derivatization. Safety and handling precautions are essential, as with many organic compounds, due to potential toxicity or environmental impact. Overall, N-(4-fluorophenyl)-1,3-benzothiazol-2-amine is of interest in both synthetic and applied chemistry fields.

Formula: C₁₃H₉FN₂S

InChI: InChI=1/C13H9FN2S/c14-9-5-7-10(8-6-9)15-13-16-11-3-1-2-4-12(11)17-13/h1-8H,(H,15,16)

SMILES: c1ccc2c(c1)nc(Nc1ccc(cc1)F)s2

Synonyms:

• Benzothiazol-2-yl-(4-fluoro-phenyl)-amine

2-Benzothiazolamine,N-(4-fluorophenyl)-

CAS: 348-45-8

Formula: C₁₃H₉FN₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 244.2874

Ref: IN-DA007H6Y

N-(4-Fluorophenyl)benzo[d]thiazol-2-amine

CAS: 348-45-8

N-(4-Fluorophenyl)benzo[d]thiazol-2-amine

Purity: ≥95%

Molecular weight: 244.29g/mol

Ref: 54-PC101696

Protein kinase inhibitor 6

CAS: 348-45-8

Protein kinase inhibitor 6

Purity: ≥95%

Molecular weight: 244.29g/mol

Ref: 54-BUP12262

N-(4-Fluorophenyl)benzo[d]thiazol-2-amine

CAS: 348-45-8

Molecular weight: 244.29

Ref: 10-F982721

Protein kinase inhibitor 6

CAS: 348-45-8

Protein kinase inhibitor 6 is a protein kinase inhibitor.

Formula: C₁₃H₉FN₂S

Purity: 98.01%

Color and Shape: Solid

Molecular weight: 244.29

Ref: TM-T9779