CAS 348-64-1

2,4-dichloro-5-fluoroaniline

Description:

2,4-Dichloro-5-fluoroaniline is an aromatic amine characterized by the presence of two chlorine atoms and one fluorine atom attached to a benzene ring, along with an amino group (-NH2). Its molecular formula is C6H4Cl2FN, and it typically appears as a solid at room temperature. This compound is known for its moderate solubility in organic solvents and limited solubility in water, which is common for many halogenated anilines. The presence of electronegative halogen atoms influences its reactivity, making it a useful intermediate in the synthesis of various pharmaceuticals, agrochemicals, and dyes. Additionally, 2,4-dichloro-5-fluoroaniline exhibits potential biological activity, which can be attributed to its structural features. However, handling this compound requires caution due to its potential toxicity and environmental impact, necessitating appropriate safety measures in laboratory and industrial settings.

Formula: C₆H₄Cl₂FN

InChI: InChI=1/C6H4Cl2FN/c7-3-1-4(8)6(10)2-5(3)9/h1-2H,10H2

SMILES: c1c(c(cc(c1Cl)N)F)Cl

Synonyms:

• Benzenamine, 2,4-dichloro-5-fluoro-
• 2,4-Dichloro-5-fluoroanline

2,4-Dichloro-5-fluoroaniline

CAS: 348-64-1

Formula: C₆H₄Cl₂FN

Purity: 98%

Color and Shape: Solid

Molecular weight: 180.0071

Ref: IN-DA00C0IL

2,4-Dichloro-5-fluoroaniline

CAS: 348-64-1

2,4-Dichloro-5-fluoroaniline

Purity: 98%

Color and Shape: Solid

Molecular weight: 180.01g/mol

Ref: 54-PC1339

2,4-Dichloro-5-fluoroaniline

CAS: 348-64-1

Formula: C₆H₄Cl₂FN

Purity: 97%

Color and Shape: Solid

Molecular weight: 180

Ref: 10-F018985