CAS 34803-67-3
:1-(4-Methyl-2-pyridinyl)piperazine
Description:
1-(4-Methyl-2-pyridinyl)piperazine, with the CAS number 34803-67-3, is a chemical compound that belongs to the class of piperazine derivatives. It features a piperazine ring, which is a six-membered saturated heterocyclic compound containing two nitrogen atoms, and is substituted with a 4-methyl-2-pyridinyl group. This substitution imparts specific pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of psychoactive and therapeutic agents. The compound is typically a solid at room temperature and exhibits moderate solubility in polar solvents due to the presence of nitrogen atoms that can engage in hydrogen bonding. Its molecular structure allows for potential interactions with various biological targets, which may include neurotransmitter receptors. As with many piperazine derivatives, it may exhibit a range of biological activities, including anxiolytic or antidepressant effects, although specific activity can vary based on the context of use and formulation. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C10H15N3
InChI:InChI=1S/C10H15N3/c1-9-2-3-12-10(8-9)13-6-4-11-5-7-13/h2-3,8,11H,4-7H2,1H3
InChI key:InChIKey=ZFBRKSGGMODDHD-UHFFFAOYSA-N
SMILES:CC=1C=C(N=CC1)N2CCNCC2
Synonyms:- 1-(4-Methyl-2-pyridinyl)piperazine
- 1-(4-Methylpyridin-2-yl)piperazine
- Piperazine, 1-(4-methyl-2-pyridinyl)-
- Piperazine, 1-(4-methyl-2-pyridyl)-
- 1-(4-Methyl-2-pyridyl)piperazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-(4-Methylpyridin-2-yl)piperazine
CAS:1-(4-Methylpyridin-2-yl)piperazineFormula:C10H15N3Purity:98%Color and Shape: colourless to yellow liquidMolecular weight:177.25g/mol1-(4-Methylpyridin-2-yl)piperazine
CAS:Formula:C10H15N3Purity:98%Color and Shape:Liquid, No data available.Molecular weight:177.2511-(4-Methylpyridin-2-yl)piperazine
CAS:Controlled ProductFormula:C10H15N3Color and Shape:NeatMolecular weight:177.2461-(4-Methylpyridin-2-yl)piperazine
CAS:1-(4-Methylpyridin-2-yl)piperazine (1MPP) is a potent 5-lipoxygenase inhibitor that inhibits the synthesis of leukotrienes and histamine. 1MPP is an effective antiasthmatic drug and has been shown to have potent activities against asthma, bronchial asthma, chronic obstructive pulmonary disease, and allergic rhinitis. The pharmacological effects of 1MPP are due to its ability to inhibit the biosynthesis of leukotrienes from arachidonic acid by blocking the enzyme 5-lipoxygenase. This inhibition leads to a decrease in inflammatory reactions caused by these molecules.Formula:C10H15N3Purity:Min. 95%Molecular weight:177.25 g/mol




