CAS 34805-17-9
:H-Tyr(Bzl)-OMe . HCl
Description:
H-Tyr(Bzl)-OMe·HCl, also known as benzyl tyrosine methyl ester hydrochloride, is a chemical compound characterized by its structure, which includes a tyrosine residue with a benzyl group and a methoxy group attached to the amino acid backbone. This compound is typically used in peptide synthesis and as a building block in the development of pharmaceuticals due to its ability to mimic natural amino acids while providing additional functional groups for further chemical modifications. The presence of the hydrochloride (HCl) indicates that it is in a salt form, which enhances its solubility in polar solvents, making it easier to handle in laboratory settings. The compound exhibits properties typical of amino acids, such as the ability to participate in hydrogen bonding and form zwitterionic species in solution. Its unique structure allows for specific interactions in biological systems, making it a valuable tool in biochemical research and drug development. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C17H20ClNO3
InChI:InChI=1/C17H19NO3.ClH/c1-20-17(19)16(18)11-13-7-9-15(10-8-13)21-12-14-5-3-2-4-6-14;/h2-10,16H,11-12,18H2,1H3;1H/t16-;/m0./s1
SMILES:COC(=O)[C@H](Cc1ccc(cc1)OCc1ccccc1)N.Cl
Synonyms:- O-Benzyl-L-Tyrosine Methyl Ester Hydrochloride
- methyl O-benzyltyrosinate
- (2S)-3-[4-(benzyloxy)phenyl]-1-methoxy-1-oxopropan-2-aminium chloride
- H-Tyr(Bzl)-OMe・HCl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
O-Benzyl-L-tyrosine methyl ester hydrochloride, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C17H20ClNO3Purity:98%Molecular weight:321.80O-Benzyl-L-Tyrosine Methyl Ester Hydrochloride
CAS:O-Benzyl-L-Tyrosine Methyl Ester HydrochloridePurity:98%Molecular weight:321.80g/molH-Tyr(Bzl)-OMe.HCl
CAS:M03102 - H-Tyr(Bzl)-OMe.HCl
Formula:C17H20ClNO3Purity:95%Color and Shape:SolidMolecular weight:321.8O-Benzyl-L-tyrosine methyl ester hydrochloride
CAS:Please enquire for more information about O-Benzyl-L-tyrosine methyl ester hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C17H19NO3·HClPurity:Min. 95%Color and Shape:PowderMolecular weight:321.8 g/mol





