CymitQuimica logo

CAS 34805-17-9

:

H-Tyr(Bzl)-OMe . HCl

Description:
H-Tyr(Bzl)-OMe·HCl, also known as benzyl tyrosine methyl ester hydrochloride, is a chemical compound characterized by its structure, which includes a tyrosine residue with a benzyl group and a methoxy group attached to the amino acid backbone. This compound is typically used in peptide synthesis and as a building block in the development of pharmaceuticals due to its ability to mimic natural amino acids while providing additional functional groups for further chemical modifications. The presence of the hydrochloride (HCl) indicates that it is in a salt form, which enhances its solubility in polar solvents, making it easier to handle in laboratory settings. The compound exhibits properties typical of amino acids, such as the ability to participate in hydrogen bonding and form zwitterionic species in solution. Its unique structure allows for specific interactions in biological systems, making it a valuable tool in biochemical research and drug development. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C17H20ClNO3
InChI:InChI=1/C17H19NO3.ClH/c1-20-17(19)16(18)11-13-7-9-15(10-8-13)21-12-14-5-3-2-4-6-14;/h2-10,16H,11-12,18H2,1H3;1H/t16-;/m0./s1
InChI key:IQKXGACPIPNLEL-NTISSMGPSA-N
SMILES:COC(=O)[C@H](Cc1ccc(cc1)OCc1ccccc1)N.Cl
Synonyms:
  • O-Benzyl-L-Tyrosine Methyl Ester Hydrochloride
  • methyl O-benzyltyrosinate
  • (2S)-3-[4-(benzyloxy)phenyl]-1-methoxy-1-oxopropan-2-aminium chloride
  • H-Tyr(Bzl)-OMe・HCl
Found 6 products.