CAS 34813-49-5
:tert-Butylsulfonamide
Description:
Tert-Butylsulfonamide is an organic compound characterized by the presence of a tert-butyl group attached to a sulfonamide functional group. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. This compound is known for its relatively low solubility in water but is soluble in organic solvents such as ethanol and acetone. Tert-Butylsulfonamide is often utilized in organic synthesis and as a reagent in various chemical reactions, particularly in the formation of sulfonamides and related compounds. It exhibits moderate stability under standard conditions but should be handled with care due to potential irritant properties. The compound's structure contributes to its unique reactivity, making it valuable in pharmaceutical and agrochemical applications. Additionally, it may serve as a building block in the synthesis of more complex molecules, highlighting its significance in synthetic organic chemistry. As with all chemical substances, proper safety measures should be observed when handling tert-butylsulfonamide to mitigate any health risks.
Formula:C4H11NO2S
InChI:InChI=1/C4H11NO2S/c1-4(2,3)8(5,6)7/h1-3H3,(H2,5,6,7)
SMILES:CC(C)(C)S(=O)(=O)N
Synonyms:- 2-Methylpropane-2-sulfonamide
- 2-Propanesulfonamide, 2-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
tert-Butylsulfonamide
CAS:Formula:C4H11NO2SPurity:>98.0%(GC)(N)Color and Shape:White to Almost white powder to crystalMolecular weight:137.20Ref: IN-DA00BZPH
1g20.00€5g43.00€10g62.00€1kgTo inquire25g81.00€2kgTo inquire100g181.00€500gTo inquiretert-Butylsulfonamide
CAS:tert-ButylsulfonamidePurity:99%Color and Shape:SolidMolecular weight:137.20g/mol(+/-)-tert-Butylsulphonamide
CAS:(+/-)-tert-Butylsulphonamide is a synthetic molecule that is a functional group with two aryl halides. It has been shown to inhibit the mitochondrial protein synthesis by preventing the nitrosylation of tyrosine residues in proteins. This inhibition prevents the production of growth factors and other bioactive molecules, leading to an increase in the cell's sensitivity to genotoxic agents. (+/-)-tert-Butylsulphonamide has also been shown to inhibit viral replication and infectivity by targeting viral RNA polymerase, which is responsible for viral transcription. The chloride anion present in (+/-)-tert-butylsulphonamide may have an inhibitory effect on viruses with a low pH environment, such as naphthalene or carbonic acid; however, it does not affect viruses with a neutral pH.END>Formula:C4H11NO2SPurity:Min. 95%Color and Shape:White PowderMolecular weight:137.2 g/mol




